Atomic structure
There are 6 chemically distinct structures. Please, select:

N[C@H]1C(O)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O