Atomic structure
There is only one chemically distinct structure:
SVG
MW
SMILES
3D mol
Ionize
CC(=O)N[C@H]1[C@@H](O)C[C@@](O)(C(=O)O)O[C@H]1[C@@H](NC(=O)C[C@@H](C)O)[C@H](C)O
378.378 g/mol (C
15
H
26
N
2
O
9
)