Main representations | Input: xDGal-ol
SNFG: 
|
Atomic structure
There is only one chemically distinct structure:
|
Carrier residue details
| Residue |
Size |
Type |
Abundance |
Structures |
WURCSProtons / Atoms |
Description |
|---|
| Gal-ol |
hex |
ol |
100 |
100 |
h2112h211112 |
galactitol |
D-Gal-ol
?-Gal-ol
| 87
13
| 87
13
|  [CH2](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[CH2](O)oooooo
2 variants possible; use an icon →oooooo
|
Structures and taxa Display 100 compounds containing Gal-ol (carrier residue): click here Display 100 compounds containing D-Gal-ol (specified building block): click here Distribution of compounds containing D-Gal-ol synthesized in major taxonomic groups, except animals:
| Kingdom: Phylum |
Compounds with D-Gal-ol |
|---|
| bacteria: Firmicutes | .31 (31.0%) |
| bacteria: Proteobacteria | .30 (30.0%) |
| fungi: Ascomycota | .15 (15.0%) |
| bacteria: Actinobacteria | .8 (8.0%) |
| fungi: Basidiomycota | .6 (6.0%) |
| bacteria: Bacteroidetes | .6 (6.0%) |
| plant: Streptophyta | .5 (5.0%) |
| archaea: Euryarchaeota | .1 (1.0%) |
|