| Enzyme / Gene |
Activity |
Object |
References |
|---|
Enzyme name: ugt51p
UniProt ID: Q06321* 
CAZy family: GT1
Gene name: ATG26/UGT51
Gene GenBank ID: 850886* | Synthesized dimer: bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4
Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4)
Donor (ID 33616): aDGlcp(1-P-P-5)xXnucU
Acceptor (ID 33987): Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4
Status: semi-direct evidence in vivo
Confirmation methods: mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation); in vitro (purified protein)
ID: 298 Notes: UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different
sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors
| Organism (ID 17220,17221): Saccharomyces cerevisiae UTL-7A, ATCC 204508
Expressed in: E. coli
Full structure (ID 34895):
Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4&highlight=1~3~bDGlc)
CSDB ID(s): 41269, 46036, 45985Molecule role: membrane glycolipid | Warnecke et al. 1999
DOI: 10.1074/jbc.274.19.13048
Cao et al. 2007
DOI: 10.4161/auto.3371
Malik et al. 2013
DOI: 10.1039/c3mb70303g
|
Synthesized dimer: bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4
Donor (ID 33616): aDGlcp(1-P-P-5)xXnucU
Acceptor (ID 33987): Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4
Status: semi-direct evidence in vivo
Confirmation methods: mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation)
ID: 511 Notes: UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different
sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors
| Organism (ID 12218): Avena sativa
Expressed in: E. coli
Full structure (ID 34895):
Molecule role: membrane glycolipid | Warnecke et al. 1999
DOI: 10.1074/jbc.274.19.13048
|
Synthesized dimer: bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4
Donor (ID 33616): aDGlcp(1-P-P-5)xXnucU
Acceptor (ID 33987): Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4
Status: semi-direct evidence in vivo
Confirmation methods: mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation)
ID: 516 Notes: UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different
sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors
| Organism (ID 9097): Dictyostelium discoideum
Expressed in: E. coli
Full structure (ID 34895):
Molecule role: membrane glycolipid |
Synthesized dimer: bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4
Donor (ID 33616): aDGlcp(1-P-P-5)xXnucU
Acceptor (ID 33987): Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4
Status: semi-direct evidence in vivo
Confirmation methods: mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation)
ID: 521 Notes: UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different
sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors
| Organism (ID 10327): Pichia pastoris
Expressed in: E. coli
Full structure (ID 34895):
Molecule role: membrane glycolipid |
#GTR ID Enzyme name Enzyme group Enzyme Genbank ID Derived ID mark Enzyme Uniprot ID Derived ID mark CAZY family Gene name Gene Genbank ID Derived ID mark Gene cluster Full structure CSDB structure ID Side product CSDB structure ID Full structure Full structure is fragment (0|1) Synthesized bond Synthesized bond location (from root ~ subst position) Donor structure ID Substrate structure Confirmation status Methods used Notes Molecule role Molecule is a model of role (0|1) Molecule is a precursor of role (0|1) Main CSDB record ID Additional CSDB record IDs CSDB organism IDs Organism names Organs and tissues References (;-separated)
298 ugt51p Q06321 * GT1 ATG26/UGT51 850886 * 34895 bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 0 bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 1~3 aDGlcp(1-P-P-5)xXnucU Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 semi-direct mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation); in vitro (purified protein) UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors membrane glycolipid 0 0 41269 46036,45985 17220,17221 Saccharomyces cerevisiae UTL-7A, ATCC 204508 E. coli Warnecke et al. 1999 (doi: 10.1074/jbc.274.19.13048); Cao et al. 2007 (doi: 10.4161/auto.3371); Malik et al. 2013 (doi: 10.1039/c3mb70303g)
511 ugt51p Q06321 * GT1 ATG26/UGT51 850886 * 34895 bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 0 bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 1~3 aDGlcp(1-P-P-5)xXnucU Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 semi-direct mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation) UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors membrane glycolipid 0 0 12218 Avena sativa E. coli Warnecke et al. 1999 (doi: 10.1074/jbc.274.19.13048)
516 ugt51p Q06321 * GT1 ATG26/UGT51 850886 * 34895 bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 0 bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 1~3 aDGlcp(1-P-P-5)xXnucU Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 semi-direct mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation) UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors membrane glycolipid 0 0 9097 Dictyostelium discoideum E. coli Warnecke et al. 1999 (doi: 10.1074/jbc.274.19.13048)
521 ugt51p Q06321 * GT1 ATG26/UGT51 850886 * 34895 bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 0 bDGlcp(1-3)Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 1~3 aDGlcp(1-P-P-5)xXnucU Subst // Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 semi-direct mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation) UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors membrane glycolipid 0 0 10327 Pichia pastoris E. coli Warnecke et al. 1999 (doi: 10.1074/jbc.274.19.13048)