Found 1 organism.
Displayed organism 1

| a-D-Manp-(1-6)-+ 10b1C19-(1-1)-+ | | a-D-Manp-(1-2)-L-myoIno-(1--P--3)--D-Gro | Pam-(1-2)-+ 10b1C19 = tuberculostearic (10-methyl stearic) acid | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ 10b1C19-(1-1)-+ | | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--D-Gro | Pam-(1-2)-+ 10b1C19 = tuberculostearic (10-methyl stearic) acid | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ 10b1C19-(1-1)-+ | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--D-Gro | Pam-(1-2)-+ 10b1C19 = tuberculostearic (10-methyl stearic) acid | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1--P--1)--LIP | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1--P--1)--LIP | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-6)-+ | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | Subst-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--D-Gro Subst = arabinan | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-+ | D-Ala-(2-1)-mPmN2-(2-5)-D-Glu-(2-1)-L-Ala-(2-8)-b-Murp | Gc-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| Gc-(1-2)-+ | Subst-(1-5)-b-D-Galf-(1-4)-a-L-Rhap-(1-3)-a-D-GlcpNAc-(1--P--6)--b-Murp Subst = arabinogalactan | Show graphically |
|
Show legend Show as text |
| -5)-a-D-Araf-(1- | Show graphically |
|
Show legend Show as text |
| -5)-b-D-Galf-(1- | Show graphically |
|
Show legend Show as text |
| Subst3-(1-5)-a-D-Araf-(1-5)-Subst2-(1-5)-a-D-Araf-(1-5)-+ | b-D-Galf-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-5)-Subst1-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-5)-b-D-Galf-(1-5)-b-D-Galf-(1-4)-Subst4 Subst1 = galactan (ID 31427); Subst2 = arabinan (ID 31426); Subst3 = hexaarabinosyl motif (ID 31422); Subst4 = linker-peptidoglycan (ID 31425) | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-2)-+ LIP-(1-1)-+ | | {{{-a-D-Manp-(1-2)-}}}a-D-Manp-(1-6)-L-myoIno-(1--P--3)--Gro | | LIP-(1-3)-+ LIP-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Manp-(1-2)-}}}/n=0-2/-a-D-Manp-(1-5)-b-D-Araf-(1--/(->5) arabinan/ | Show graphically |
|
Show legend Show as text |
| L-myoIno-(1--P--5)--b-D-Araf-(1--/(->5) arabinan/ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-6)-+ | -4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-6)-a-D-Glcp-(1-6)-+ | -4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-+ | a-D-Araf-(1-5)-b-D-Galf-(1-1)-Et | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-1)-Et | Show graphically |
|
Show legend Show as text |
| a-D-Araf-(1-5)-a-D-Araf-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-D-Araf-(1-3)-a-D-Araf-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-D-Araf-(1-5)-+ | a-D-Araf-(1-3)-a-D-Araf-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-D-Araf-(1-5)-+ | a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1--/9-decen-1-ol/ | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-b-D-Galf-(1--/9-decen-1-ol/ | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-6)-b-D-Galf-(1--/9-decen-1-ol/ | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1--/9-decen-1-ol/ | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-6)-b-D-Galf-(1--/9-decen-1-ol/ | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Galf-(1-5)-b-D-Galf-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-1)-Dec | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-2)-a-D-Glcp-(1-1)-Dec | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-1)-Dec | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-1)-Dec | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-1)-Dec | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-{{{-b-D-Galf-(1-5)-b-D-Galf-(1-6)-}}}+ | Mycolic-(1-5)-+ | | | Mycolic-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | Mycolic-(1-5)-+ | {{{-a-D-Araf-(1-5)-}}}/n=7/-a-D-Araf-(1-3)-+ | | | | | Mycolic-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-b-D-Galf-(1-5)-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=3/-a-D-Galf-(1-4)-b-L-Rhap-(1-4)-a-D-GlcpNAc-(1---P---/peptidoglycan/ | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Manp-(1-2)-}}}/n=0-2/-a-D-Manp-(1-5)-a-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-+ | {{{-a-D-Manp-(1-2)-}}}/n=0-2/-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-{{{-a-D-Araf-(1-5)-}}}+ | {{{-a-D-Manp-(1-2)-}}}/n=0-2/-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | {{{-a-D-Manp-(1-2)-}}}/n=0-2/-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-{{{-a-D-Araf-(1-5)-}}}{{{-a-D-Araf-(1-5)-}}}D-Araf-(1--/mannan core ID 10733/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ a-D-Manp-(1-2)-+ a-D-Manp-(1-2)-+ LIP-(1-2)-+ | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-INO-(1--P--1)--Gro-(?--/MPI anchor/ | LIP-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1--/rest of arabinogalactan/ | Show graphically |
|
Show legend Show as text |
| Subst-(1-5)-a-D-Araf-(1-5)-+ | Subst-(1-5)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1--/rest of arabinogalactan/ Subst = arabinogalactan | Show graphically |
|
Show legend Show as text |
| -5)-a-D-Araf-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Galf-(1-5)-b-D-Galf-(1- | Show graphically |
|
Show legend Show as text |
| a-L-Fucp2Me-(1-3)-b-D-Glcp-(1-3)-a-L-Rhap2Me-(1-3)-a-L-Rhap2Me-(1-3)-b-D-Glcp-(1-3)-a-L-Rhap4Me-(1-3)-a-D-Glcp6Me-(1-1)-a-D-Glcp | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-3)-a-D-GlcpNAc-(1---P---/peptidoglycan/ | Show graphically |
|
Show legend Show as text |
| a-L-Rhap2Me-(1--/(->1) Phenolphthiocerol dimycocerosate/ | Show graphically |
|
Show legend Show as text |
| a-L-Fucp2Me3Me4Me-(1-3)-a-L-Rhap-(1-3)-a-L-Rhap-(1--/Phenolphthiocerol dimycocerosate/ | Show graphically |
|
Show legend Show as text |
| a-L-Fucp2Me4Me-(1-3)-a-L-Rhap-(1-3)-a-L-Rhap2Me-(1--/phenolphthiocerol A dimycocerosate/ | Show graphically |
|
Show legend Show as text |
| a-L-Fucp2Me3Me4Me-(1-3)-a-L-Rhap-(1-3)-a-L-Rhap2Me-(1--/phenolphthiotriol A dimycocerosate/ | Show graphically |
|
Show legend Show as text |
| a-L-Fucp2Me3Me4Me-(1-3)-a-L-Rhap-(1-3)-a-L-Rhap2Me-(1--/phenolphthiocerol dimycocerosate/ | Show graphically |
|
Show legend Show as text |
| a-L-Fucp2Me3Me4Me-(1-3)-a-L-Rhap-(1-3)-a-L-Rhap2Me-(1--/unknown/ | Show graphically |
|
Show legend Show as text |
| LIP-(1-2)-+ | S-2)-a-D-Glcp-(1-1)-a-D-Glcp | LIP-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-6)-+ | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | a-Araf-(1-5)-Araf-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-INO-(1--P--?)--Gro-(?--/Glycerol/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-D-Ara-ol | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-D-Araf | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-2)-+ LIP-(1-1)-+ | | Subst-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--Gro-(?--/phosphatidylinositol, PI/ | LIP-(1-2)-+ Subst = arabinan-(mannan core) | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-2)-+ LIP-(1-1)-+ | | Subst-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--Gro-(?--/phosphatidylinositol, PI/ | LIP-(1-2)-+ Subst = mannan | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-2)-+ LIP-(1-2)-+ | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--Gro-(?--/phosphatidylinositol, lyso-PI/ | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-6)-+ | a-D-Araf-(1-5)-a-D-Araf-(1-5)-b-D-Galf-(1-5)-b-D-Galf-(1--/arabinogalactan/ | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1--/(1->5)aDAraf of arabinogalactan/ | Show graphically |
|
Show legend Show as text |
| a-D-Araf-(1-5)-+ | a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1--/(1->5)aDAraf of arabinogalactan/ | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf | Show graphically |
|
Show legend Show as text |
| Mycolic-(1-5)-+ | Mycolic-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | Mycolic-(1-5)-+ | | | Mycolic-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf | Show graphically |
|
Show legend Show as text |
| LIP-(1-3)-+ | LIP-(1-2)-a-D-Glcp-(1-1)-a-D-Glcp | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-6)-+ LIP-(1-1)-+ | | LIP-(1-6)-a-D-Manp-(1-2)-L-myoIno-(1--P--3)--Gro-(?--/phosphatidylinositol, lyso-PI/ | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-6)-+ LIP-(1-1)-+ | | LIP-(1-6)-a-D-Manp-(1-2)-L-myoIno-(1--P--3)--Gro-(?--/phosphatidylinositol, PI/ | LIP-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-2)-+ LIP-(1-1)-+ | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--D-Gro-(?--/phosphatidylinositol, PI or lyso-PI/ | LIP-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-2)-+ LIP-(1-1)-+ | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--D-Gro-(?--/phosphatidylinositol, PI or lyso-PI/ | Show graphically |
|
Show legend Show as text |
| Mycolic-(?-5)-+ | Mycolic-(?-5)-b-D-Araf-(1-2)-b-D-Araf-(1-5)-+ | Mycolic-(?-5)-+ | | | Mycolic-(?-5)-b-D-Araf-(1-2)-b-D-Araf-(1-3)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-+ | Mycolic-(?-5)-+ | | | Mycolic-(?-5)-b-D-Araf-(1-2)-b-D-Araf-(1-5)-+ | | | Mycolic-(?-5)-+ | | | | | Mycolic-(?-5)-b-D-Araf-(1-2)-b-D-Araf-(1-3)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Araf-(1-3)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-D-Ara | Show graphically |
|
Show legend Show as text |
| -4)-a-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| Cyclic -6)-b-D-Galf-(1-5)-b-D-Galf-(1- | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-6)-+ LIP-(1-2)-+ | | LIP-(1-6)-a-D-Manp-(1-2)-L-myoIno-(1--P--3)--Gro-(?--/phosphatidylinositol, lyso-PI/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-a-D-Araf-(1-2)-a-D-Araf-(1-5)-+ a-D-Manp-(1-2)-+ | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-a-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-D-Man | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Galf-(1-5)-b-D-Galf-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-5)-a-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | ?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-a-D-Manp-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ | a-D-Manp-(1-2)-+ a-D-Manp-(1-2)-+ | | | | b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-}}}/n=5/-a-D-Araf-(1-5)-a-D-Araf-(1-?)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-}}}/n=5/-a-D-Manp | Show graphically |
|
Show legend Show as text |
| a-D-6dxylHexp-4-ulo-(1---P---P---5)-dT | Show graphically |
|
Show legend Show as text |
| a-D-6dlyxHexp-4-ulo-(1---P---P---5)-dT | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-3)-a-D-GlcpNAc-(1--/octyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-4)-a-L-Rhap-(1-3)-a-D-GlcpNAc-(1--/octyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-4)-a-L-Rhap-(1-3)-a-D-GlcpNAc-(1--/octyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-4)-a-L-Rhap-(1-3)-a-D-GlcpNAc-(1--/octyl/ | Show graphically |
|
Show legend Show as text |
| Subst-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-4)-a-L-Rhap-(1-3)-a-D-GlcpNAc-(1---P---/peptidoglycan/ Subst = arabinogalactan | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1--/8-aminooctanol/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-2)-+ | | Ste-(1-3)-+ | | | | a-D-Manp-(1-6)-+ | | | Ste-(1-2)-Gro-(1--P--1)--+ | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno | Ste-(1-6)-a-D-Manp-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | a-D-Araf-(1-5)-+ a-D-Manp-(1-6)-+ | | | | a-D-Araf-(1-5)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/OCH2CH2CH2CH2CH2CH2SH/ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-2)-D-GroA-(3-P | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-2)-D-GroA | Show graphically |
|
Show legend Show as text |
| b-D-Galf2Ac3Ac5Ac6Ac-(1-4)-a-L-Rhap-(1--/C8H17/ | Show graphically |
|
Show legend Show as text |
| Man-(1-?)-+ 9b1Ach-(1-2)-+ | | Man-(1-?)-L-myoIno-(1--P--3)--D-Gro-(1-1)-Pam | Show graphically |
|
Show legend Show as text |
| b-Man-(1---P---/dolichol/ | Show graphically |
|
Show legend Show as text |
| C18={t5,t8,t11,t14}-(1-2)-+ | EtN-(1--P--?)--D-GlcNAc-(1-?)-L-myoIno-(?--P--3)--D-Gro-(1-1)-Ste | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Manp-(1-2)-}}}a-D-Manp-(1-5)-a-D-Araf-(1-2)-a-D-Araf-(1-5)-+ a-D-Manp-(1-2)-+ | | {{{-a-D-Manp-(1-2)-}}}a-D-Manp-(1-5)-a-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp | Show graphically |
|
Show legend Show as text |
| ?%a-D-Glcp-(1-4)-a-D-Glcp-(1-6)-+ | -4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1-4)-a-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| Mycolic-(1-5)-+ | Mycolic-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | Mycolic-(1-5)-+ | | | Mycolic-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-+ | Mycolic-(1-5)-+ | | | Mycolic-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | Mycolic-(1-5)-+ | | | | | Mycolic-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=13/-+ | | /Variants 0/-+ | | b-D-Galf-(1-5)-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=10/-b-D-Galf-(1-6)-b-D-Galf-(1-5)-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=3/-b-D-Galf-(1-4)-a-L-Rhap-(1-3)-a-D-GlcpNAc-(1---P---/peptidoglycan/ /Variants 0/ is: Suc-(1-2)- OR (exclusively) D-GalpN-(1-2)- | Show graphically |
|
Show legend Show as text |
| 10b1C19-(1-3)-+ | a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-+ | a-D-Manp-(1-6)-+ a-D-Manp-(1-2)-+ Pam-(1-?)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-2)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}/n=10/-a-D-Manp-(1-6)-a-D-Manp-(1-6)-INO-(1--P--1)--Gro-(?--/phosphatidylinositol anchor of LAM/ | | 10b1C19-(1-?)-+ Pam-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| Mycolic-(1-?)-+ | Mycolic-(1-?)-a-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | Mycolic-(1-?)-+ | ANY-(1-3)-+ b-D-Galf-(1-6)-+ ANY-(1-4)-+ | | | | | Mycolic-(1-?)-a-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-b-D-Galf-(1-5)-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=30/-b-D-Galf-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-4)-a-L-Rhap-(1-3)-a-D-GlcpNAc-(1--P--6)--b-Murp2Ac-(1-4)-b-D-GlcpNAc-(1--/peptidogycan/ | PEP-(2-8)-+ | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=20-40/-b-D-Galf-(1-?)-Rhap-(1-?)-GlcpNAc-(1---P---P----/(->1)decaprenol/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | -6)-a-D-Manp-(1-6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| Pam-(1-2)-a-D-Manp-(1-2)-+ 10b1C19-(1-3)-+ | | a-D-Manp-(1-6)-Subst-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--1)--Gro | Pam-(1-2)-+ Subst = mannan backbone polysaccharide (ID 12034) | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | b-D-Araf-(1-2)-+ | | | a-D-Xylf5S5Me-(1-4)-a-D-Manp-(1-6)-a-D-Manp-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1--/arabinan-LAM-mannan/ Xyl5S = 5-thio-xylose | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=12/-a-D-Araf-(1-5)-+ | | ?%Suc-(1-2)-+ | | Mycolic-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | Mycolic-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-+ | | | Mycolic-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | | | Mycolic-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=12/-a-D-Araf-(1-5)-+ | | | | ?%a-D-GalpN-(1-2)-+ | | | | Subst1-(1-?)-Subst2-(1-?)-b-D-Galf-(1-5)-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=2/-b-D-Galf-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-6)-{{{-b-D-Galf-(1-5)-}}}/n=4/-b-D-Galf-(1-5)-b-D-Galf Subst1 = peptidoglycan; Subst2 = linker | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | | | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | | | | | | | b-D-Araf-(1-2)-{{{-a-D-Araf-(1-5)-}}}/n=5/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-3)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-+ | | | | | | | | | b-D-Araf-(1-2)-{{{-a-D-Araf-(1-5)-}}}/n=6/-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=3/-a-D-Araf-(1-3)-+ | | | | | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ | | | | | | | | | a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | | | LIP-(1-?)-a-D-Manp-(1-?)-+ LIP-(1-1)-+ | | | | | | | | a-D-Xylf5S5Me-(1-4)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=11/-a-D-Araf-(1-5)-D-Araf-(1-?)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-?)-L-myoIno-(1--P--3)--Gro | | Suc-(1-2)-+ LIP-(1-2)-+ Xyl5S = 5-thio-xylose | Show graphically |
|
Show legend Show as text |
| a-D-Quip4N-(1---P---P---5)-dT | Show graphically |
|
Show legend Show as text |
| a-D-Quip4NFo-(1---P---P---5)-dT | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-2)-+ LIP-(1-2)-+ | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--1)--Gro | LIP-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-6)-D-Galf-(1-1)-Subst Subst = 9-decen-1-ol = SMILES C=CCCCCCCC{1}CO | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-6)-D-Galf-(1-1)-Oc | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-6)-D-Galf-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-5)-D-Galf-(1-1)-Subst Subst = 9-decen-1-ol = SMILES C=CCCCCCCC{1}CO | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-5)-D-Galf-(1-1)-Oc | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-D-Galf-(1-1)-Oc | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-D-Galf-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-D-Galf-(1-1)-Allyl | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-6)-b-D-Galf-(1-6)-b-D-Galf-(1-6)-b-D-Galf-(1-6)-b-D-Galf-(1-6)-D-Galf-(1-1)-Allyl | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-b-D-Galf-(1-5)-b-D-Galf-(1-5)-D-Galf-(1-1)-Oc | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-D-Galf-(1-1)-Oc | Show graphically |
|
Show legend Show as text |
| b-D-Galf-(1-5)-D-Galf-(1-1)-Et | Show graphically |
|
Show legend Show as text |
| Subst2-(1-10)-+ | b-L-Rhap2Me-(1-1)-Subst1-28Me-(8-1)-Pam Subst1 = 4-(2,4,22-trihydroxy-21-methyl)tetracosylphenol = SMILES CC{28}C(O)C(C)CCCCCCCCCCCCCCCC{10}C(O)C{8}C(O)Cc1cc{1}c(O)cc1; Subst2 = 2,4,6-trimethylcerotic acid = SMILES CCCCCCCCCCCCCCCCCCCCC(C)CC(C)CC(C){1}C(=O)O | Show graphically |
|
Show legend Show as text |
| LIP-(1-23)-+ | a-L-Fucp2Me3Me4Me-(1-3)-a-L-Rhap-(1-3)-a-L-Rhap2Me-(1-1)-Subst-(31-1)-Me-(?--/common lipid core/ | LIP-(1-25)-+ Subst = SMILES C{31}C(O)C(C)CCCCC{25}(O)C{23}C(O)CCCCCCCCCCCCCCCCc1cc{1}c(O)cc1 | Show graphically |
|
Show legend Show as text |
| Subst-(1-6)-+ | Subst-(1-6)-a-D-Glcp-(1-1)-a-D-Glcp Subst = α-mycolic acid = SMILES CCCCCCCCCCCCCCCCCCCCCCCC[C@H]({1}C(=O)O)[C@@H](O)CCCCCCCCCCCCCCCCCC1CC1CCCCCCCCCCC2CC2CCCCCCCCCCCCCCCCCC | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1--/(->5) cell wall/ | Show graphically |
|
Show legend Show as text |
| L-Cys2Ac-(1-2)-a-D-GlcpN-(1-3)-L-myoIno | Show graphically |
|
Show legend Show as text |
| Subst-(1-5)-+ | {{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=3/-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=3/-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=8/-b-D-Galf-(1-6)-b-D-Galf Subst = branched arabinan | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1--/lipoarabinomannan/ | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-1)-Subst Subst = 8-aminooctanol = SMILES NCCCCCCC{1}CO | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-4)-a-D-Manp-(1-5)-b-D-Araf-(1-5)-a-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | Subst-(1-4)-a-D-Manp-(1-4)-a-D-Manp-(1-5)-b-D-Araf-(1-5)-a-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf Subst = α-D-5-deoxy-5-methylthio-xylofuranose = SMILES CSC[C@H]1O{1}[C@H](O)[C@H](O)[C@H]1O | Show graphically |
|
Show legend Show as text |
| D-Ala-(1-2)-D-Ala-(1-?)-mPmN2-(1-?)-D-Glu-(1-2)-L-Ala-(1-8)-a-Murp2Ac-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| Ste-(1-6)-a-D-Manp-(1-2)-+ R-10b1C19-(1-3)-+ | | {{{-a-D-Manp-(1-2)-}}}/n=4/-a-D-Manp-(1-6)-L-myoIno-(1--P--1)--D-Gro | | Ste-(1-3)-+ Ste-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| Beh-(1-6)-+ | Beh-(1-6)-a-D-Glcp-(1-1)-a-D-Glcp | Show graphically |
|
Show legend Show as text |
| Subst-(1-6)-+ | Subst-(1-6)-a-D-Glcp-(1-1)-a-D-Glcp Subst = (+)-corynomycolic acid = SMILES CCCCCCCCCCCCCCC{2}[C@@H](O)[C@@H](CCCCCCCCCCCCCC){1}C(=O)O | Show graphically |
|
Show legend Show as text |
| Subst-(1-6)-a-D-Glcp-(1-1)-a-D-Glcp Subst = (+)-corynomycolic acid = SMILES CCCCCCCCCCCCCCC{2}[C@@H](O)[C@@H](CCCCCCCCCCCCCC){1}C(=O)O | Show graphically |
|
Show legend Show as text |
| Subst-(1-6)-a-D-Glcp Subst = α-mycolic acid = SMILES CCCCCCCCCCCCCCCCCCCCCCCC[C@H]({1}C(=O)O)[C@@H](O)CCCCCCCCCCCCCCCCCC1CC1CCCCCCCCCCC2CC2CCCCCCCCCCCCCCCCCC | Show graphically |
|
Show legend Show as text |
| Subst-(1-6)-a-D-Glcp Subst = (+)-corynomycolic acid = SMILES CCCCCCCCCCCCCCC{2}[C@@H](O)[C@@H](CCCCCCCCCCCCCC){1}C(=O)O | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Glcp-(1-4)-}}}a-D-Glcp-(1-6)-+ | -4)-{{{-a-D-Glcp-(1-4)-}}}/n=4-5/-a-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| Pam-(1-2)-+ S-2)-+ | | Subst-(1-3)-a-D-Glcp-(1-1)-a-D-Glcp Subst = 2,4,6,8,10,12,14,16-octamethyl-17-hydroxytetratriacontanoic acid = SMILES CCCCCCCCCCCCCCCCCC(O)C(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C){1}C(=O)O | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1--P--1)--Subst Subst = 4,8,12,16,20-pentamethyltricosanol = SMILES CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CC{1}CO | Show graphically |
|
Show legend Show as text |
| Mycolic-(1-6)-a-D-Glcp Mycolic = mycolic acid = SMILES CCCCCCCCCCCCCCCCCCCCCCCCC({1}C(=O)O)C(O)CCCCCCCCCCCCCCCCCCCC1CC1CCCCCCCCCCCCCCCCC(=O)C(C)CCCCCCCCCCCCCCCC | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-6)-+ Mar-(1-2)-+ | | a-D-Manp-(1-2)-L-myoIno-(1--P--3)--Gro-(1-1)-10b1C19 | Show graphically |
|
Show legend Show as text |
| Mycolic-(1-6)-+ | a-D-Glcp-(1-1)-a-D-Glcp | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Araf-(1-5)-+ a-D-Manp-(1-2)-+ | | {{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-}}}a-D-Araf-(1-2)-{{{-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-}}}a-D-Manp | Show graphically |
|
Show legend Show as text |
| LIP-(1-6)-a-D-Manp-(1-2)-+ LIP-(1-1)-+ | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--Gro | | LIP-(1-4)-+ LIP-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-3)-Ser-(?--/Ser/Thr-pilin/ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-6)-+ | -4)-a-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Manp-(1-2)-}}}/n=6-7/-a-D-Manp-(1-2)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-+ | | | D-Manp-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | | | Suc-(1-3)-+ | | | | | | | a-D-Xylf5S5Me-(1-4)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-+ | | | | Suc-(1-2)-+ | | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | | | | | b-D-Araf-(1-2)-{{{-a-D-Araf-(1-5)-}}}/n=5/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-+ | | | | | Suc-(1-3)-+ | | | | | | | Suc-(1-3)-+ a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Araf-(1-2)-b-D-Araf-(1-5)-a-D-Araf-(1-5)-+ | | a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-+ a-D-Manp-(1-2)-+ | | | | | | | | b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-D-Araf-(1-?)-}}}a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=13/-a-D-Araf-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}/n=2/-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}/n=2/-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/phosphatidyl-myo-inositol anchor/ | Suc-(1-2)-+ Xyl5S = 5-thio-xylose | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-+ | | ?%Suc-(1-2)-+ | | b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=12/-a-D-Araf-(1-5)-+ | | ?%Suc-(1-2)-+ | | Mycolic-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | Mycolic-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-5)-+ | | | Mycolic-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | | | Mycolic-(1-?)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=12/-a-D-Araf-(1-5)-+ | | | | ?%a-D-GalpN-(1-2)-+ | | | | Subst1-(1-?)-Subst2-(1-?)-b-D-Galf-(1-5)-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=2/-b-D-Galf-(1-6)-b-D-Galf-(1-5)-b-D-Galf-(1-6)-b-D-Galf-(1-5)-{{{-b-D-Galf-(1-6)-b-D-Galf-(1-5)-}}}/n=5/-b-D-Galf-(1-6)-b-D-Galf Subst1 = peptidoglycan; Subst2 = linker | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | a-D-Araf-(1-4)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=13/-a-D-Araf-(1--/mannan core-phoshatidyl-inositol/ | Suc-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-6)-+ /Variants 2/-+ | | /Variants 1/-a-D-Manp-(1-2)-L-myoIno-(1--P--3)--Gro | | /Variants 0/-+ /Variants 3/-+ /Variants 0/ is: Ste-(1-3)- OR (exclusively) Pam-(1-3)- OR (exclusively) Mar-(1-3)- /Variants 1/ is: Ste-(1-6)- OR (exclusively) Pam-(1-6)- OR (exclusively) Mar-(1-6)- /Variants 2/ is: Ste-(1-2)- OR (exclusively) Pam-(1-2)- OR (exclusively) Mar-(1-2)- /Variants 3/ is: Ste-(1-1)- OR (exclusively) Pam-(1-1)- OR (exclusively) Mar-(1-1)- | Show graphically |
|
Show legend Show as text |
| /Variants 1/-a-D-Manp-(1-2)-+ /Variants 2/-+ | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-L-myoIno-(1--P--3)--Gro | | /Variants 0/-+ /Variants 3/-+ /Variants 0/ is: Ste-(1-3)- OR (exclusively) Pam-(1-3)- OR (exclusively) Mar-(1-3)- /Variants 1/ is: Ste-(1-6)- OR (exclusively) Pam-(1-6)- OR (exclusively) Mar-(1-6)- /Variants 2/ is: Ste-(1-2)- OR (exclusively) Pam-(1-2)- OR (exclusively) Mar-(1-2)- /Variants 3/ is: Ste-(1-1)- OR (exclusively) Pam-(1-1)- OR (exclusively) Mar-(1-1)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}/n=6/-+ | SUG-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | SUG-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | | SUG-(1-5)-b-D-Araf-(1-2)-{{{-a-D-Araf-(1-5)-}}}/n=5/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-3)-+ | | | SUG-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-+ | | | | | SUG-(1-5)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | a-D-Manp-(1-2)-+ | | | | | SUG-(1-5)-b-D-Araf-(1-2)-{{{-a-D-Araf-(1-5)-}}}/n=5/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=6/-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=14/-a-D-Araf-(1-2)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}/n=4/-a-D-Manp-(1-6)-a-D-Manp-(1--/(1->6)phosphatidylinositol mannoside (PIM) anchor/ | Suc-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-L-Fucp2Me3Me4Me-(1-3)-a-L-Rhap-(1-3)-a-L-Rhap2Me-(1-1)-LIP | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Glcp-(1-4)-}}}/n=2/-a-D-Glcp-(1-4)-+ | -6)-a-D-Glcp-(1-4)-{{{-a-D-Glcp-(1-4)-}}}/n=2/-a-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| -2)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Araf-(1-5)-b-D-Araf-(1-5)-+ | b-D-Galf-(1-5)-b-D-Galf-(1-6)-+ | | | a-D-Araf-(1-5)-+ | | | | | a-D-Araf-(1-3)-b-D-Araf-(1-5)-b-D-Araf-(1-5)-b-D-Galf-(1-5)-b-D-Galf-(1-6)-b-D-Galf | Show graphically |
|
Show legend Show as text |
| New query | Export IDs | Home | Help |
Execution: 5 sec