Found 23 organisms.
Displayed organisms from 1 to 15

| 3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | Myr-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc-(1-4)-a-D-ManpNAc3NAcA-(1--/2-(p-aminophenyl)ethyl/ | Show graphically |
|
Show legend Show as text |
| D-ManpNAc3NAcA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| EtN-(1--P--0)--?%P-4)-+ | a-D-GlcpN-(1-7)-+ | | | a-D-GlcpA-(1-2)-L-gro-a-D-manHepp-(1-3)-+ | | | a-D-GalpNA-(1-6)-+ | | | | | L-gro-a-D-manHepp-(1-4)-+ | | | | | | | a-D-GlcpNAc-(1-4)-b-D-ManpNAc3NAcA-(1-3)-b-L-FucpNAc4NMe-(1-6)-a-D-GlcpN-(1-4)-b-D-Glcp-(1-4)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| ?%3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | Myr-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | Myr-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpN-(1-7)-+ | b-D-GlcpA-(1-2)-L-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| a-D-GlcpN-(1-4)-+ | a-D-GalpNA-(1-6)-D-Glc | Show graphically |
|
Show legend Show as text |
| a-D-GlcpN-(1-7)-+ | b-D-Glcp-(1-3)-b-D-GlcpA-(1-2)-L-gro-a-D-manHepp-(1-5)-Kdo | Show graphically |
|
Show legend Show as text |
| a-D-GlcpN-(1-4)-+ a-D-GlcpN-(1-7)-+ | | a-D-GalpNA-(1-6)-b-D-Glcp-(1-3)-b-D-GlcpA-(1-2)-L-gro-a-D-manHepp-(1-5)-Kdo | Show graphically |
|
Show legend Show as text |
| D-GlcpN-(1-7)-+ | D-GlcpA-(1-2)-L-gro-D-manHepp-(1-3)-+ | D-GalpNA-(1-6)-+ | | | HEP-(1-4)-+ | | | | | D-GlcpNAc-(1-4)-D-ManpNAcA-(1-3)-L-FucpNAc?Me-(1-6)-D-GlcpN-(1-4)-D-Glcp-(1-4)-L-gro-D-manHepp-(1-5)-Kdo-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAcA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-ribHexpNAcA-3-ulo-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc3NA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc3NAcA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-ManpNAc3NAcA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| GlcpA-(1-2)-+ | a-D-GlcpN-(1-7)-Hepp-(1-3)-+ | GalpNA-(1-6)-+ | | | Hepp-(1-4)-+ | | | | | GlcpNAc-(1-4)-ManpNAc3NAcA-(1-3)-FucpNAc?Me-(1-6)-GlcpN-(1-4)-Glcp-(1-4)-Hepp-(1-5)-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| GlcpA-(1-2)-+ | a-D-GlcpN-(1-7)-Hepp-(1-3)-+ | GalpNA-(1-6)-+ | | | Hepp-(1-4)-Glcp-(1-4)-Glcp-(1-4)-Hepp-(1-5)-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc-(1-4)-b-D-ManpNAc3NAcA-(1-3)-a-D-FucpNAc4NMe-(1--/(1->?)oligosaccharide/ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc3NAc-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpN-(1- | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | 3HOMyr-(1-3)-+ | | | Myr-(1-3)-3HOMyr-(1-2)-b-D-Glcp-(1-6)-a-D-Glcp-(1-P | | P-4)-+ | | 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Myr-(1-3)-3HOMyr-(1-2)-b-D-Glcp-(1-6)-a-D-Glcp-(1-P | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | 3HOMyr-(1-2)-b-D-Glcp-(1-6)-a-D-Glcp-(1-P | Show graphically |
|
Show legend Show as text |
| a-D-GlcpN-(1-7)-+ | a-D-GlcpA-(1-2)-L-gro-a-D-manHepp-(1-3)-+ | | P-4)-+ | | a-D-GalpNA-(1-6)-+ | | | L-gro-a-D-manHepp-(1-4)-+ | | P-4)-+ | | | | a-D-GlcpNAc-(1-4)-b-D-ManpNAc3NAcA-(1-3)-a-D-FucpNAc4N(50%)Me-(1-6)-a-D-GlcpN-(1-4)-b-D-Glcp-(1-4)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | R-3HOMyr-(1-3)-+ | | | Myr-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp-(1-4)-+ | a-D-GlcpNAc-(1-4)-b-D-ManpNAc3NAcA-(1-3)-b-L-FucpNAc4NMe-(1-6)-b-D-GlcpNAc-(1--/(->1)(CH2)3NH2 (3-aminopropyl)/ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpN-(1-7)-+ | a-D-GlcpA-(1-2)-L-gro-a-D-manHepp-(1-3)-+ | a-D-GalpNA-(1-6)-+ | | | L-gro-a-D-manHepp-(1-4)-+ | | | | | a-D-GlcpNAc-(1-4)-b-D-ManpNAc3NAcA-(1-3)-b-L-FucpNAc4NMe-(1-6)-a-D-GlcpN-(1-4)-b-D-Glcp-(1-4)-L-gro-a-D-manHepp-(1-5)-a-Kdop | Show graphically |
|
Show legend Show as text |

| Ko | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-Ko | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kop-(2-1)-Allyl | Show graphically |
|
Show legend Show as text |
| a-Kop-(2-4)-a-Kdop-(2-1)-Allyl | Show graphically |
|
Show legend Show as text |
| -3)-a-D-Rhap-(1-3)-a-D-Rhap-(1-4)-a-D-Galp-(1- | Show graphically |
|
Show legend Show as text |
| Pyr-(2-?)-+ | -3)-b-D-Glcp-(1-3)-a-D-Galp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Gal-(1-6)-+ | b-D-Galp-(1-2)-a-D-Rhap-(1-4)-+ | | | -3)-b-D-Glcp-(1-3)-a-D-GlcpA-(1-3)-a-D-Manp-(1- | a-D-Galp-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOPam-(1-2)-+ | ?%b-L-Arap4N-(1--P--1)--+ | | | ?%b-L-Arap4N-(1--P--4)--+ | | | | | Myr-(1-3)-R-3HOPam-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN | | ?%R-3HOMyr-(1-3)-+ | | ?%R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOPam-(1-2)-+ | b-L-Arap4N-(1--P--4)--+ | | | Myr-(1-3)-R-3HOPam-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN | | R-3HOMyr-(1-3)-+ P-1)-+ | Show graphically |
|
Show legend Show as text |
| R-Pyr-(2-6:2-4)-+ | -3)-b-D-Glcp-(1-3)-a-D-Galp-(1- | Show graphically |
|
Show legend Show as text |
| -3)-a-D-Rhap-(1-3)-a-D-Rhap-(1-2)-a-D-Rhap-(1- | Show graphically |
|
Show legend Show as text |
| D-Rhap-(1-3)-a-D-Rhap-(1-3)-D-Thre-ol | Show graphically |
|
Show legend Show as text |
| a-D-Rhap-(1-3)-a-D-Rhap-(1-2)-Gro | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-6)-+ | b-D-Galp-(1-2)-a-D-Rhap-(1-4)-+ | | | -3)-b-D-Glcp-(1-3)-a-D-GlcpA-(1-3)-a-D-Manp-(1- | a-D-Galp-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Glcp-(1-3)-a-D-GlcpA-(1-3)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-2)-D-Rha-ol | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-6)-a-D-Manp-(1-3)-D-Glc-ol | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kdop-(2--/BSA/ | Show graphically |
|
Show legend Show as text |
| a-Kop-(2-4)-a-Kdop-(2--/BSA/ | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kop-(2--/BSA/ | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2--/BSA/ | Show graphically |
|
Show legend Show as text |
| a-Kop-(2--/BSA/ | Show graphically |
|
Show legend Show as text |
| a-D-Rhap-(1-3)-a-D-Rhap-(1-4)-a-D-Galp-(1--/3-(N-acetyl-L-cysteino)propyl/ | Show graphically |
|
Show legend Show as text |
| ?%b-L-Arap4N-(1-8)-a-Kop-(2-4)-+ | a-L-Rhap-(1-2)-+ b-D-Glcp-(1-4)-+ | | | | L-gro-a-D-manHepp-(1-7)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Galp2Ac-(1-4)-a-D-Galp-(1-3)-b-D-Galp-(1-5)-b-Kdop-(2- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Fruf-(2- | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-6)-+ | a-D-Galp-(1-2)-+ | | | b-D-Galp-(1-2)-a-D-Rhap-(1-4)-a-D-GlcpA-(1-3)-a-D-Manp-(1-3)-D-Glc-ol | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| -2)-b-D-Ribf-(1-6)-a-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| b-L-Arap4N-(1-8)-a-Kop-(2-4)-a-Kdop-(2-1)-Me | Show graphically |
|
Show legend Show as text |
| Pyr-(2-6:2-4)-+ | -3)-b-D-Glcp-(1-3)-a-D-Galp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Galp3(%)Ac4(%)Ac6(%)Ac-(1-6)-+ | b-D-Galp2(%)Ac3(%)Ac4(%)Ac6(%)Ac-(1-2)-a-D-Rhap-(1-4)-+ | | | -3)-a-D-GlcpA-(1-3)-a-D-Manp-(1-3)-b-D-Glcp-(1- | a-D-Galp3(%)Ac4(%)Ac-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-2)-+ | -6)-b-D-Galp-(1-4)-a-D-GlcpA-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpNAc-(1-6)-b-D-GlcpNAc-(1-6)-b-D-GlcpN-(1- | Show graphically |
|
Show legend Show as text |
| R-Pyr-(2-6:2-4)-+ | -3)-b-D-Glcp-(1-3)-a-D-Galp-(1- | Show graphically |
|
Show legend Show as text |
| R-3HOPam-(1-2)-+ | R-3HOMyr-(1-3)-+ | | | Myr-(1-3)-R-3HOPam-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOPam-(1-2)-+ | b-L-Arap4N-(1-0)-?%P-1)-+ | | | Myr-(1-3)-3HOPam-(1-2)-+ | | | | | ?%b-L-Arap4N-(1--P--4)--b-D-GlcpN-(1-6)-a-D-GlcpN | | ?%3HOMyr-(1-3)-+ | | ?%3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-3)-+ | ?%b-L-Arap4N-(1--P--1)--+ | | | ?%b-L-Arap4N-(1--P--4)--+ | | | | | Myr-(1-3)-R-3HOPam-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN | | R-3HOMyr-(1-3)-+ | | R-3HOPam-(1-2)-+ | Show graphically |
|
Show legend Show as text |


| Arap4N-(1--P--?)--+ LIP-(?-?)-+ | | b-L-Arap4N-(1-8)-a-Kop-(2-4)-Kdop-(2-?)-D-GlcpN-(1-?)-D-GlcpN-(1--P--1)--Arap4N | LIP-(?-?)-+ | Show graphically |
|
Show legend Show as text |
| ?%b-L-Arap4N-(1-8)-a-Kop-(2-4)-a-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| b-L-Arap4N-(1-8)-a-Kop-(2-4)-a-Kdop-(2-1)-Me | Show graphically |
|
Show legend Show as text |
| a-Kop1Me-(2-4)-a-Kdop1Me-(2-1)-Me | Show graphically |
|
Show legend Show as text |
| a-Kop-(2-4)-a-Kdop | Show graphically |
|
Show legend Show as text |
| b-L-Arap4N-(1-8)-a-Kop-(2-4)-a-Kdop | Show graphically |
|
Show legend Show as text |
| b-L-Arap4NMeMe2Me3Me-(1-8)-a-Kop1Me3Me4Me5Me7Me-(2-4)-a-Kdop1Me5Me7Me8Me-(2-1)-Me | Show graphically |
|
Show legend Show as text |

| -6)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-D-Manp-(1-P | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-D-Man | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-3)-+ | a-D-Manp-(1-6)-+ | | | a-D-Manp-(1-3)-a-D-Manp-(1-6)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1-4)-Asn | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | {{{-b-D-Manp-(1-2)-}}}/n=1-7/-b-D-Manp-(1--P--6)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | {{{-a-D-Manp-(1-2)-}}}/n=7/-a-D-Manp-(1-2)-+ | | | | | | | | | | | {{{-a-D-Manp-(1-2)-}}}/n=5/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}/n=5/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | {{{-a-D-Manp-(1-2)-}}}/n=5/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}/n=5/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | {{{-a-D-Manp-(1-2)-}}}/n=5/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | | | | | {{{-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | | | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-+ | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-{{{-a-D-Manp-(1-2)-}}}/n=5/-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-D-Manp-(1-4)-D-GlcpNAc-(1-4)-D-GlcpNAc-(1--/protein/ | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | /Variants 0/-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | a-D-Manp-(1-6)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-6)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- /Variants 0/ is: a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | /Variants 0/-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- /Variants 0/ is: a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)-- | Show graphically |
|
Show legend Show as text |
| Subst-(1-4)-b-GlcNAc-(1-4)-GlcNAc1N-(1-4)-Asn Subst = inner core | Show graphically |
|
Show legend Show as text |
| -6)-b-Glc-(1- | Show graphically |
|
Show legend Show as text |
| -3)-b-Glc-(1- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-GlcNAc-(1- | Show graphically |
|
Show legend Show as text |
| GlcNAc-(1-?)-GlcNAc1N-(1-4)-Asn | Show graphically |
|
Show legend Show as text |
| -6)-a-Manp-(1- | Show graphically |
|
Show legend Show as text |
| a-Man-(1-2)-a-Man-(1-2)-a-Man-(1-3)-Ser | Show graphically |
|
Show legend Show as text |
| a-Man-(1-2)-a-Man-(1-2)-a-Man-(1-3)-Thr | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-6)-+ | b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-D-Glcp | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-D-Glcp | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-+ | b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-+ | b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-+ | | | -6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-Manp-(1-2)-a-Manp-(1-2)-a-Manp-(1-2)-a-Manp-(1-2)-a-Manp-(1--/(->3) Ser/Thr-protein/ | Show graphically |
|
Show legend Show as text |
| b-Manp-(1-2)-a-D-Manp-(1--P--6)--a-D-Manp-(1-2)-L-myoIno-(1--P--1)--CER | Show graphically |
|
Show legend Show as text |
| -4)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-6)-+ | -3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-6)-+ | ?%a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-+ | b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-+ | -3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1--/protein-polyacrylamide conjugate/ | Show graphically |
|
Show legend Show as text |
| -4)-b-D-GlcpN6Ac-(1- | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| /Variants 0/-+ | -6)-a-D-Manp-(1- /Variants 0/ is: b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- OR (exclusively) b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- OR (exclusively) b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)--a-D-Manp-(1--/cell wall mannan/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--/cell wall mannan/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-4dlyxHexp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp4Me-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| b-D-4dlyxHexp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| /Variants 0/-+ | -6)-a-D-Manp-(1- /Variants 0/ is: b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- OR (exclusively) b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- OR (exclusively) b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)--a-D-Manp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-1)-Pr | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1--P--6)--+ | {{{-b-D-Manp-(1-2)-}}}{{{-a-D-Manp-(1-2)-}}}/n=1-3/-a-D-Manp-(1-2)-+ | -6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-8)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-7)-Subst Subst = 2-[4-(hydroxymethyl)triazol-1-yl]ethanol = SMILES O{7}CCn1cc({8}CO)nn1 | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-a-D-Manp-(1-8)-+ | b-D-Manp-(1-2)-a-D-Manp-(1-7)-Subst Subst = 2-[4-(hydroxymethyl)triazol-1-yl]ethanol = SMILES O{7}CCn1cc({8}CO)nn1 | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-6)-+ | b-D-Glcp-(1-3)-b-D-Glcp-(1-3)-D-Glcp | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Glcp-(1-3)-}}}/n=1-4/-D-Glcp | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | {{{-a-D-Manp-(1-6)-+ | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--+ | | | | | | | ?%a-D-Manp-(1-6)-+ | | | | | | | | | /Variants 0/-b-D-Glcp-(1-2)-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpN-(1-4)-b-D-GlcpN1N-(1-2)-L-Asn-(?--/X-Ser/Thr-protein/ /Variants 0/ is: ?%a-D-Manp-(1-2)-?%a-D-Manp-(1-3)- OR (exclusively) ?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1--/(->3) Ser/Thr-protein/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--Subst Subst = α-1,6-mannan backbone | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Glcp-(1-3)-}}}b-D-Glcp-(1-3)-+ {{{-b-D-Glcp-(1-3)-}}}b-D-Glcp-(1-3)-+ {{{-b-D-Glcp-(1-3)-}}}b-D-Glcp-(1-3)-+ | | | -6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-Man-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=0-6/-a-D-Manp-(1--P--6)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | {{{-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-}}}Subst-(?-4)-b-GlcNAc-(1-4)-GlcNAc1N-(1-4)-L-Asn-(?--/(->1) protein/ Subst = inner core | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1--/(->?) N-terminated peptide epitope/ | Show graphically |
|
Show legend Show as text |
| -4)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Glcp-(1-3)-}}}?%b-D-Glcp-(1-6)-+ | -3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}a-D-Manp-(1--/(->4) Asn-X-Ser/Thr (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}?%a-D-Manp-(1-2)-+ | -6)-a-D-Man-(1- | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Manp-(1-2)-}}}/n=0-4/-a-D-Manp-(1--/(->4) L-Ser/(->3) L-Thr (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-3)-+ | a-D-Man-(1-3)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1--/(->4) Asn-X-Ser/Thr (protein)/ | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1--/(->3) L-Thr/L-Ser (protein)/ | Show graphically |
|
Show legend Show as text |
| ?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-a-D-Manp-(1--/(->3) L-Thr/L-Ser (protein)/ | Show graphically |
|
Show legend Show as text |
| ?%a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1--/(->3) L-Thr/L-Ser (protein)/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1--/(->3) L-Thr/L-Ser (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1--/(->3) L-Thr/L-Ser (protein)/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1--/(->3) L-Thr/L-Ser (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/(->6) structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1--/structure ID 46365/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-+ | | | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | b-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-+ | | | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | b-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-+ | | | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | b-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-+ | | | {{{-b-D-Manp-(1-2)-}}}b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | b-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-+ | | | a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | b-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | b-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | b-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc1N-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| ?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-a-D-Manp-(1--/(->3) L-Thr/L-Ser (protein)/ | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}/n=4-16/-a-D-Manp-(1--P--?)--a-D-Manp-(1-?)-L-myoIno-(1--P--1)--CER | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--?)--a-D-Manp-(1-?)-L-myoIno-(1--P--1)--CER | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1--P--?)--a-D-Manp-(1-?)-L-myoIno-(1--P--1)--CER | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Glcp-(1-3)-}}}b-D-Glcp-(1-3)-+ | -6)-{{{-b-D-Glcp-(1-6)-}}}b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| /Variants 0/-a-D-Manp-(1-?)-+ | {{{-a-D-Manp-(1-6)-}}}/n=9/-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-?)-+ | | | {{{-b-D-Manp-(1-2)-}}}/n=3/-a-D-Manp-(1--P--4)--a-D-Manp-(1-?)-a-D-Manp-(1-?)-a-D-Manp-(1-?)-a-D-Manp-(1--/core/ /Variants 0/ is: {{{-a-D-Manp-(1-?)-}}}/n=0-4/-a-D-Manp-(1-?)- OR (exclusively) b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-?)-a-D-Manp-(1-?)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=3/-b-D-Manp-(1--P--4)--a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=5/-b-D-Manp-(1-2)-+ | | | a-D-Manp-(1-3)-{{{-b-D-Manp-(1-2)-}}}/n=3/-b-D-Manp-(1-2)-+ | | | | | {{{-b-D-Manp-(1-2)-}}}/n=3/-b-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | {{{-b-D-Manp-(1-2)-}}}/n=3/-b-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-}}}a-D-Manp | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-+ | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1--/(->4) Asn (protein)/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | /Variants 0/-+ | | | | | {{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1--/(->4) Asn-X-Ser/Thr (protein)/ /Variants 0/ is: ?%b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- OR (exclusively) a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}/n=0-1/-a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1--/(->4) xLAsn-X-Ser/Thr (protein)/ | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| R-2HOPam-(1-2)-+ | b-D-Glcp-(1-1)-9b1SphdC19 | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | /Variants 0/-+ | | | | | {{{-a-D-Manp-(1-6)-}}}a-D-Man-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1--/(->4) L-Asn-X-Ser/Thr (protein)/ /Variants 0/ is: a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}/n=0-1/-a-D-Manp-(1-2)- OR (exclusively) {{{-b-D-Manp-(1-2)-}}}/n=1-2/-a-D-Manp-(1-2)-a-D-Manp-(1-2)- OR (exclusively) a-D-Manp-(1-3)-a-D-Manp-(1-2)-+ | a-D-Manp-(1-3)-a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| ?%a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | /Variants 0/-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-2)-+ | | | | | | | {{{-b-D-Manp-(1-2)-}}}a-D-Manp-(1--P--6)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- /Variants 0/ is: ?%a-D-Manp-(1-2)-a-D-Manp-(1-3)- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)- OR (exclusively) b-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Manp-(1-3)-}}}/n=0-3/-a-D-Manp-(1--/(->3) L-Thr/L-Ser (protein)/ | Show graphically |
|
Show legend Show as text |
| /Variants 0/-+ | -6)-a-D-Manp-(1- /Variants 0/ is: ?%b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- OR (exclusively) a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}/n=0-1/-a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Glcp-(1-3)-}}}b-D-Glcp-(1-6)-+ | -3)-{{{-b-D-Glcp-(1-3)-}}}/n=5/-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-4)-b-D-Glcp2Ac | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1--/(->4) Asn-X-Ser/Thr (protein)/ | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}/n=1-5/-b-D-Manp | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}/n=1-3/-a-D-Manp-(1-2)-a-D-Manp | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-D-Manp | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-6)-+ a-D-Manp-(1-6)-+ | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-D-Manp | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-P | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-P | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-3)-b-D-Glcp-(1-1)-PhNO2 | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-6)-b-D-Glcp-(1-1)-PhNO2 | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}/n=1-4/-{{{-a-D-Manp-(1-2)-}}}/n=2-3/-a-D-Manp | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}?%a-D-Manp-(1--P--6)--+ | ?%a-D-Manp-(1-6)-+ | | | ?%b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-?%a-D-Manp-(1-?)-?%a-D-Manp-(1-?)-?%a-D-Manp-(1-?)-?%a-D-Manp-(1-?)-?%a-D-Manp-(1-?)-+ | {{{-a-D-Manp-(1-6)-}}}Subst-(1-4)-b-D-GlcpN-(1-4)-b-D-GlcpN1N-(1-4)-L-Asn-(?--/protein/ Subst = core mannan | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | ?%b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--+ | | | | | ?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-/Variants 2/-/Variants 1/-/Variants 0/-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-+ | | | | | {{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc /Variants 0/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- /Variants 1/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- /Variants 2/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | /Variants 2/-/Variants 1/-/Variants 0/-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-+ | | | | | {{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc /Variants 0/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- /Variants 1/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- /Variants 2/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | /Variants 1/-?%a-D-Manp-(1-2)-/Variants 0/-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-+ | | | | | {{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc /Variants 0/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- /Variants 1/ is: ?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | ?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-/Variants 1/-/Variants 0/-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-+ | | | | | {{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc /Variants 0/ is: ?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- /Variants 1/ is: ?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--+ | | | | | ?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-/Variants 1/-/Variants 0/-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-+ | | | | | {{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc /Variants 0/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- /Variants 1/ is: a-D-Manp-(1-6)-?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}?%a-D-Manp-(1-2)-+ | -6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Manp-(1-?)-}}}?%a-D-Manp-(1-?)-+ | -6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| -2)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Glcp-(1-3)-}}}b-D-Glcp-(1-6)-+ | -3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Glcp-(1-3)-}}}?%b-D-Glcp-(1-4)-+ | -3)-b-D-Glcp-(1- | {{{-b-D-Glcp-(1-3)-}}}?%b-D-Glcp-(1-6)-+ | Show graphically |
|
Show legend Show as text |
| D-Araf-(1-7)-Bn | Show graphically |
|
Show legend Show as text |
| Ery-ol | Show graphically |
|
Show legend Show as text |
| D-gro-L-glcHep | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-6)-D-Glc | Show graphically |
|
Show legend Show as text |
| D-Man | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-3)-+ | a-D-Glcp-(1-2)-b-D-Fruf | Show graphically |
|
Show legend Show as text |
| b-D-Ribf-(1-9)-Subst Subst = 2-methyl-hypoxanthine = SMILES Cc2n{9}c1[nH]cnc1c(=O)[nH]2 | Show graphically |
|
Show legend Show as text |
| b-D-Glcp1S-(1-1)-Subst Subst = (Z)-N-hydroxybut-3-enimidothioic acid = SMILES C=CC/C({1}S)=N/O | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=2-7/-b-D-Manp-(1--P--?)--a-D-Manp-(1-2)-{{{-a-D-Manp-(1-2)-}}}a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=1-4/-{{{-a-D-Manp-(1-2)-}}}/n=2-3/-a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}a-D-Manp-(1-2)-+ | | | | | {{{-a-D-Manp-(1-2)-}}}a-D-Manp-(1-2)-+ | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| EtN-(1--P--2)--+ | EtN-(1--P--6)--+ | | | EtN-(1--P--6)--+ | | /Variants 0/-+ | | | | /Variants 1/-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-4)-b-D-GlcpNAc-(1-6)-L-myoIno /Variants 0/ is: LIP-(1-3)-+ | Crt-(1-2)-Gro-(1--P--1)-- OR (exclusively) Crt-(1-2)-phSphC18-(1--P--1)-- /Variants 1/ is: a-D-Manp-(1-3)- OR (exclusively) a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | {{{-b-D-Manp-(1-2)-}}}/n=3/-b-D-Manp-(1--P--?)--a-D-Manp-(1-2)-+ | | | | | /Variants 1/-a-D-Manp-(1-2)-+ | | | | | | | {{{-a-D-Manp-(1-6)-+ | | | | | | | /Variants 0/-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Man-(1-3)-b-D-Manp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc /Variants 0/ is: b-D-Manp-(1-2)- OR (exclusively) {{{-b-D-Manp-(1-2)-}}}/n=3/-b-D-Manp-(1-2)- OR (exclusively) a-D-Manp-(1-3)-a-D-Manp-(1-2)- /Variants 1/ is: ?%a-D-Manp-(1-3)- OR (exclusively) a-D-Manp-(1-3)-?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}/n=4/-?%a-D-Manp-(1--P--6)--+ | b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-{{{-a-D-Manp-(1-2)-}}}/n=1-3/-a-D-Manp-(1-2)-+ | {{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1--/(->6) inner core-Asn(protein)/ | Show graphically |
|
Show legend Show as text |
| Subst-(1-2)-EtN-(1--P--2)--{{{-b-D-Manp-(1-2)-}}}/n=1-3/-b-D-Manp-(1-1)-Et Subst = protein | Show graphically |
|
Show legend Show as text |
| /Variants 0/-+ | -6)-a-D-Manp-(1- /Variants 0/ is: {{{-b-D-Manp-(1-2)-}}}a-D-Manp-(1-0)-?%P-?)- OR (exclusively) {{{-a-D-Manp-(1-2)-}}}/n=1-3/-?%a-D-Manp-(1-2)- OR (exclusively) ?%a-D-Manp-(1-6)-+ | ?%a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-?%a-D-Manp-(1-2)- OR (exclusively) {{{-b-D-Manp-(1-2)-}}}/n=1-3/-a-D-Manp-(1-2)-?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-1)-EtN-(?--/biotin/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-1)-EtN-(?--/biotin/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-1)-EtN-(?--/biotin/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-1)-EtN-(?--/biotin/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-1)-EtN-(?--/biotin/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-1)-EtN-(?--/biotin/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-1)-EtN-(?--/biotin/ | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-1)-EtN-(?--/biotin/ | Show graphically |
|
Show legend Show as text |
| /Variants 0/-+ | b-D-Glcp-(1-1)-S,R-9b1SphdC19 /Variants 0/ is: R-2HOSte-(1-2)- OR (exclusively) R-2HOPam-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-1)-a-D-Glcp | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | /Variants 1/-+ {{{-a-D-Manp-(1-6)-+ | | | | | | ?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1-0)-?%P-?)-?%a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpN-(1-4)-b-D-GlcpN1N-(1-2)-L-Asn-(?--/X-L-Ser/L-Thr-protein/ /Variants 0/ is: a-D-Manp-(1-3)- OR (exclusively) {{{-b-D-Manp-(1-2)-}}}/n=1-3/-b-D-Manp-(1-2)- /Variants 1/ is: a-D-Manp-(1-6)-+ | a-D-Manp-(1-2)-?%a-D-Manp-(1-3)- OR (exclusively) /Variants 0/-?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Manp-(1-2)-}}}/n=4/-a-D-Manp-(1--/(->3) X-Ser/Thr-protein/ | Show graphically |
|
Show legend Show as text |
| Pam-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=3/-b-D-Manp-(1--P--6)--b-D-Manp-(1-2)-L-myoIno-(1--P--1)--phSphC18 | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}/n=0-3/-a-D-Manp-(1-0)-?%P-6)-+ | ?%a-D-Manp-(1-6)-+ | | | /Variants 0/-{{{-a-D-Manp-(1-2)-}}}/n=0-1/-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | -6)-a-D-Manp-(1- /Variants 0/ is: ?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-?%b-D-Manp-(1-2)- OR (exclusively) ?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-3)-b-D-Manp-(1-3)-b-D-Manp-(1--/vaccine support/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | {{{-b-D-Manp-(1-2)-}}}/n=3/-b-D-Manp-(1-0)-?%P-6)-+ | | | | | /Variants 1/-a-D-Manp-(1-2)-10%a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-6)-{{{-a-D-Manp-(1-6)-}}}a-D-Manp-(1-6)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-b-D-GlcpN-(1-4)-b-D-GlcpN1N-(1-2)-L-Asn-(?--/X-L-Ser/L-Thr-protein/ /Variants 0/ is: a-D-Manp-(1-3)- OR (exclusively) b-D-Manp-(1-2)-b-D-Manp-(1-2)- /Variants 1/ is: a-D-Manp-(1-3)- OR (exclusively) b-D-Manp-(1-2)- OR (exclusively) /Variants 0/-a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Manp-(1-2)-}}}/n=0-6/-a-D-Manp-(1-0)-?%P-6)-+ | /Variants 0/-?%a-D-Manp-(1-2)-?%a-D-Manp-(1-2)-+ | -6)-a-D-Manp-(1- /Variants 0/ is: ?%a-D-Manp-(1-3)- OR (exclusively) ?%a-D-Manp-(1-6)-+ | ?%a-D-Manp-(1-2)-?%a-D-Manp-(1-3)-?%a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-Subst Subst = cholesterol = SMILES C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC{3}[C@@H](C4)O)C)C | Show graphically |
|
Show legend Show as text |
| /Variants 0/-a-D-Manp-(1-3)-Subst /Variants 0/ is: Ste-(1-6)- OR (exclusively) Pam-(1-6)- OR (exclusively) Myr-(1-6)- OR (exclusively) Lau-(1-6)- OR (exclusively) C18={?}-(1-6)- OR (exclusively) C16={?,?}-(1-6)- OR (exclusively) LIP-(1-6)- Subst = cholesterol = SMILES C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC{3}[C@@H](C4)O)C)C | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-3)-Subst Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 | Show graphically |
|
Show legend Show as text |
| /Variants 0/-a-D-Manp-(1-3)-Subst /Variants 0/ is: Ste-(1-6)- OR (exclusively) Pam-(1-6)- OR (exclusively) Myr-(1-6)- OR (exclusively) Lau-(1-6)- OR (exclusively) C18={?}-(1-6)- OR (exclusively) C16={?,?}-(1-6)- OR (exclusively) LIP-(1-6)- Subst = ergosterol = SMILES O{3}[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@]3(C)CC4 | Show graphically |
|
Show legend Show as text |
| Crt-(1-2)-+ | b-D-Manp-(1-2)-L-myoIno-(1--P--1)--phSphC18 | Show graphically |
|
Show legend Show as text |
| Lig-(1-2)-+ | b-D-Manp-(1-2)-L-myoIno-(1--P--1)--phSphC18 | Show graphically |
|
Show legend Show as text |
| {{{-b-D-Glcp-(1-6)-}}}b-D-Glcp-(1-6)-+ | -3)-b-D-Glcp-(1-3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| /Variants 0/-+ | -6)-a-D-Manp-(1- /Variants 0/ is: b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- OR (exclusively) b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- OR (exclusively) b-D-Manp-(1-2)-?%b-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-?%a-D-Manp-(1--P--6)--a-D-Manp-(1-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=0-2/-?%b-D-Manp-(1-2)-a-D-Manp-(1--P--6)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=0-4/-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-6)-+ | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-6)-+ | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | | | | | | | | | {{{-a-D-Manp-(1-2)-}}}/n=0-3/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| b-D-Manp-(1-2)-b-D-Manp-(1-2)-b-D-Manp-(1-2)-a-D-Manp-(1--P--6)--a-D-Manp-(1--/α1,6-mannan backbone/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1--/Ser/Thr/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-{{{-b-D-Manp-(1-2)-}}}/n=0-2/-a-D-Manp-(1--P--6)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | {{{-b-D-Manp-(1-2)-}}}/n=4/-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | {{{-b-D-Manp-(1-2)-}}}/n=3/-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | | | {{{-b-D-Manp-(1-2)-}}}/n=2/-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | | | | | b-D-Manp-(1-2)-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-6)-+ | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-6)-+ | | | | | | | | | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-3)-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | {{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | | | | | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-a-D-Manp-(1--/(CH2)3NH2, linker-biotin/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-{{{-b-D-Manp-(1-2)-}}}/n=0-2/-a-D-Manp-(1--P--6)--a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | b-D-Manp-(1-2)-{{{-b-D-Manp-(1-2)-}}}/n=0-2/-{{{-a-D-Manp-(1-2)-}}}/n=2/-a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-2)-a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | -6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1- | Show graphically |
|
Show legend Show as text |

| Gal | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1--/O-para-nitrophenyl or S-para-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1--/para-nitrothiophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-Glcp-(1--/para-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| a-L-Fucp-(1-2)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| a-Neup5Ac-(2-6)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| a-Neup5Ac-(2-3)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-D-GlcNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-a-D-GlcNAc-(1-7)-Bn | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcNAc-(1--/(CH2)8CO2CH3 or para-nitrothiophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcNAc-(1-2)-D-Man | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-+ | a-L-Fucp-(1-3)-b-D-GlcpNAc-(1-2)-D-Man | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-D-Gal | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Gal-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Gal-(1-4)-b-D-GlcNAc-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-6)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-D-Gal | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-6)-+ | b-D-Galp-(1-3)-b-D-GlcpNAc-(1-3)-D-Gal | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-D-GlcpNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-b-D-GlcpNAc-(1--/(CH2)2NHC(O)OCH2Ph/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| a-L-Fucp-(1-4)-+ | b-D-Galp-(1-3)-D-GlcNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-D-GalNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-a-D-GalNAc-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-+ | a-D-GlcNAc-(1-6)-a-D-GalNAc-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-3)-a-D-GalNAc-(1--/(CH2)8CO2CH3/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-6)-D-GlcNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-Xyl-(1-7)-Bn | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-a-D-Galp-(1-4)-b-D-Xyl-(1-7)-Bn | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-4)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-3)-b-D-Galp-(1-4)-b-D-GlcNAc-(1--/(CH2)8CO2CH3/ | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-6)-a-D-Glcp-(1-2)-b-D-Frup | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-6)-a-D-Glcp-(1-6)-a-D-Glcp-(1-2)-b-D-Frup | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-6)-D-Man | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-6)-b-D-Manp-(1-4)-D-GlcNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-4)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-D-Man | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-6)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-D-Man | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-6)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-D-GlcNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-6)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-4)-+ | | | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-3)-D-Man | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-6)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-4)-+ | | | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-3)-b-D-Manp-(1-4)-D-GlcNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-3)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-6)-+ | | | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-6)-D-Man | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-3)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-6)-+ | | | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-6)-b-D-Manp-(1-4)-D-GlcNAc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-6)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-6)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-4)-+ | | | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-2)-a-D-Manp-(1-3)-D-Man | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-b-D-Glcp-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-GalpNAc-(1-3)-b-D-Galp-(1-4)-b-D-Glcp-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-3)-a-D-Galp-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| -3)-a-D-Fucp4NAc-(1-4)-b-D-ManpNAcA-(1-4)-a-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Myr-(1-3)-3HOMyr-(1-3)-+ | | | | | Myr-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Subst-(2-6)-+ 3HOMyr-(1-3)-+ Subst = core oligosaccharide | Show graphically |
|
Show legend Show as text |
| a-Neup5Ac-(2-6)-+ | -6)-b-D-Galf-(1-3)-b-D-GalpNAc-(1-3)-b-D-Galp-(1- | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| a-L-Arap4N-(1--P--1)--Und | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | Subst-(2-6)-+ | | | Myr-(1-3)-3HOMyr-(1-3)-+ | | | | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | b-L-Arap4N-(1--P--4)--+ 3HOMyr-(1-3)-+ Subst = core oligosaccharide | Show graphically |
|
Show legend Show as text |
| P-8)-Kdo | Show graphically |
|
Show legend Show as text |
| Kdo | Show graphically |
|
Show legend Show as text |
| Kdop-(2--P--5)--C | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | 3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | Myr-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-3)-+ EtN-(1---P---P---4)-+ EtN-(1---P---P---4)-+ | | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-Kdo | L-gro-a-D-manHepp-(1-7)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-6)-+ | a-D-GlcpNAc-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1--/inner core/ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc-(1-7)-L-gro-a-D-manHepp-(1-7)-+ | a-D-GlcpNAc-(1-3)-+ | a-Kdop-(2-4)-a-Kdop-(2-4)-+ | | | a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Galp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-Kdo | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-+ | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1--/inner core/ | Show graphically |
|
Show legend Show as text |
| a-L-Arap4N-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc-(1-7)-L-gro-a-D-manHepp-(1-7)-+ | Subst-(1-3)-b-D-Glcp-(1-3)-+ | EtN-(1--P--4)--+ a-Kdo-(2-4)-+ | | | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-b-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdo-(2--/lipid A/ | P-4)-+ Subst = O-antigen | Show graphically |
|
Show legend Show as text |
| Subst-(1-3)-b-D-Glcp-(1-3)-+ L-gro-a-D-manHepp-(1-7)-+ EtN-(1--P--4)--+ a-Kdo-(2-4)-+ | | | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-b-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdo-(2--/lipid A/ | P-4)-+ Subst = O-antigen | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-Glcp-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-3)-a-D-GlcpNAc-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-3)-b-D-Galp-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-GalpNAc-(1-3)-b-D-Galp-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Glcp-(1-4)-b-D-GlcpNAc-(1--/p-nitrophenyl/ | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| ?%Pam-(1-3)-R-3HOMyr-(1-2)-+ | ?%b-L-Arap4N-(1--P--4)--+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1--P--0)--?%P-1)-EtN | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Subst-(2-6)-+ | | R-3HOMyr-(1-3)-+ Subst = core oligosaccharide | Show graphically |
|
Show legend Show as text |
| Cyclic -3)-a-D-Fucp4NAc-(1-4)-b-D-ManpNAcA-(1-4)-a-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| Pam-(1-3)-R-3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-+ | L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| L-gro-b-D-manHepp-(1---P---P---5)-A | Show graphically |
|
Show legend Show as text |
| D-gro-b-D-manHepp-(1---P---P---5)-A | Show graphically |
|
Show legend Show as text |
| L-gro-b-D-manHepp-(1---P---P---5)-A | Show graphically |
|
Show legend Show as text |
| D-Ala-(?-?)-PmN2-(?-?)-D-Glu-(2-1)-L-Ala-(2-8)-+ | -4)-b-D-GlcpNAc-(1-4)-b-Murp2Ac-(1- | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kdop-(2--/(CH2)3S(CH2)2NHCSNH-BSA/ | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-8)-a-Kdop-(2-4)-a-Kdop-(2--/(CH2)3S(CH2)2NHCSNH-BSA/ | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcNAc-(1-6)-D-GlcNAc-ol | Show graphically |
|
Show legend Show as text |
| P-4)-+ | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcNAc-(1-6)-D-GlcNAc-ol | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-8)-a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcNAc-(1-6)-D-GlcNAc-ol | Show graphically |
|
Show legend Show as text |
| P-4)-+ | a-Kdop-(2-8)-a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcNAc-(1-6)-D-GlcNAc-ol | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-8)-a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcN-(1-6)-D-GlcN-ol | Show graphically |
|
Show legend Show as text |
| P-4)-+ | a-Kdop-(2-8)-a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcN-(1-6)-D-GlcN-ol | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1-4)-b-D-GlcpNAc-(1-4)-D-GlcNAc-(1--/Fig. 1/ | Show graphically |
|
Show legend Show as text |
| S-Pyr-(2-4:2-3)-b-D-Galp-(1-4)-b-D-GlcpA-(1-3)-b-D-Galp-(1-4)-+ | -3)-b-L-Fucp-(1-4)-a-L-Fucp-(1-3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| S-Pyr-(2-6:2-4)-b-D-Galp-(1-4)-b-D-GlcpA-(1-3)-b-D-Galp-(1-4)-+ | -3)-b-L-Fucp-(1-4)-a-L-Fucp-(1-3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-L-Fucp-(1-3)-+ | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-+ a-L-Fucp-(1-3)-+ | | a-L-Fucp-(1-3)-b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| a-L-Fucp-(1-3)-+ a-L-Fucp-(1-3)-+ | | b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | R-3HOMyr-(1-3)-+ | | | R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | 3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-Glcp-(1-6)-a-D-Glcp-(1-P | | 3HOMyr-(1-3)-+ | | 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-+ | | | | | | | L-gro-a-D-manHepp-(1-5)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-+ | | | | | | | L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpN-(1-7)-L-gro-a-D-manHepp-(1-7)-+ | b-D-Glcp-(1-3)-+ | EtN-(1---P---P---4)-+ a-Kdop-(2-4)-+ | | | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop | P-4)-+ | Show graphically |
|
Show legend Show as text |
| /Variants 0/-a-Kdop-(2-4)-+ | EtN-(1---P---P---4)-+ | | | a-D-Galp-(1-6)-+ | EtN-(1---P---P---4)-+ | | | | | a-D-GlcpNAc-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop | L-gro-a-D-manHepp-(1-7)-+ /Variants 0/ is: ?%a-D-Galp-(1-7)- OR (exclusively) Kdop-(2-4)- | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-+ | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1--/(1->3) inner core/ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-3)-+ | Myr-(1-3)-R-3HOMyr-(1-3)-+ ?%P---P--1)-+ | | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN | | P-4)-+ | | R-3HOMyr-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Myr-(1-3)-3HOMyr-(1-3)-+ | | | | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Kdop-(2-?)-Kdop-(2-6)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-3)-+ | Myr-(1-3)-3HOMyr-(1-3)-+ ?%P---P--1)-+ | | | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN | | P-4)-+ 3HOMyr-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-+ | D-Ala-(2-1)-D-Ala-(2-1)-mPmN2-(2-5)-D-Glu-(2-1)-L-Ala-(2-8)-a-Murp2Ac-(1---P---P----/undecaprenol-Z8E3/ | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-+ | Ala-(2-1)-PmN2-(2-5)-Glu-(2-1)-Ala-(2-8)-Mur2Ac | Show graphically |
|
Show legend Show as text |
| a-Abep-(1-3)-+ | -2)-a-D-Manp-(1-4)-a-L-Rhap-(1-3)-a-D-Galp-(1- | Show graphically |
|
Show legend Show as text |
| -8)-a-Neup5Ac-(2-8)-a-Neup5Ac-(2- | Show graphically |
|
Show legend Show as text |
| -3)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-D-Manp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-GalpNAc-(1-4)-b-D-Galp-(1-4)-b-D-Glcp-(1-?)-CER-(?--/Ceramide/ | Show graphically |
|
Show legend Show as text |
| Gc-(1-5)-a-Neup-(2-3)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| a-Neup5Ac-(2-3)-b-D-Galp-(1-4)-b-D-Glcp-(1-?)-CER-(?--/Ceramide/ | Show graphically |
|
Show legend Show as text |
| Gc-(1-5)-a-Neup-(2-3)-b-D-Galp-(1-4)-b-D-Glcp-(1-?)-CER-(?--/Ceramide/ | Show graphically |
|
Show legend Show as text |
| Gc-(1-5)-a-Neup4Ac-(2-3)-b-D-Galp-(1-4)-b-D-Glcp-(1-?)-CER-(?--/Ceramide/ | Show graphically |
|
Show legend Show as text |
| Gc-(1-5)-a-Neup-(2-3)-b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-b-D-Glcp-(1-?)-CER-(?--/Ceramide/ | Show graphically |
|
Show legend Show as text |
| Gc-(1-5)-a-Neup-(2-3)-b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Galp-(1-4)-b-D-Glcp-(1-?)-CER-(?--/Ceramide/ | Show graphically |
|
Show legend Show as text |
| a-D-Fucp4NAc-(1-4)-b-D-ManpNAcA-(1-4)-a-D-GlcpNAc-(1---P---/(P->P) C55-P, (->1) undecaprenyl monophosphate/ | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-Mur2Ac | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-+ | PmN2-(2-5)-D-Glu-(2-1)-Ala-(2-8)-Mur2Ac | Show graphically |
|
Show legend Show as text |
| D-Rhap2Me-(1-2)-+ | D-Manp2Me-(1-4)-D-GlcpNAcA-(1-4)-D-GlcpA-(1-4)-D-Glcp-(1-4)-D-GlcpA2Me-(1-4)-D-Manp-(1-3)-Ser | Show graphically |
|
Show legend Show as text |
| L-Fucp-(1-2)-b-D-Galp-(1-4)-D-Glc | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-2)-a-L-Rhap-(1-5)-a-Kdop | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp-(1-7)-+ | a-D-Galp-(1-6)-+ | | | a-D-GlcpNAc-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp-(1-7)-+ | a-D-Galp-(1-6)-+ | | | b-D-GlcpNAc-(1-6)-a-D-Glcp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc-(1-3)-+ L-gro-a-D-manHepp-(1-7)-+ | | a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Galp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp-(1-7)-+ | a-D-Galp-(1-6)-+ | | | a-D-GlcpNAc-(1-2)-a-D-Glcp-(1-2)-a-D-Galp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-3)-+ L-gro-a-D-manHepp-(1-7)-+ | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-+ L-gro-a-D-manHepp-(1-6)-+ | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-D-Man | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| Tyr-(1-2)-+ | a-D-Manp-(1-2)-a-D-Manp-(1-3)-Thr-(1-2)-Val | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-a-D-Manp-(1-3)-Thr | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-+ | D-Ala-(2-1)-D-Ala-(2-1)-PmN2-(2-5)-D-Glu-(2-1)-Ala-(2-8)-Mur2Ac | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-+ | D-Ala-(2-1)-PmN2-(2-5)-D-Glu-(2-1)-Ala-(2-8)-Mur2Ac | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-+ | D-Glu-(2-1)-Ala-(2-8)-Mur2Ac | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| -3)-b-D-Glcp-(1-3)-b-D-Glcp-(1-6)-b-D-Glcp-(1-6)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-8)-a-Kdop-(2-4)-a-Kdo | Show graphically |
|
Show legend Show as text |
| D-GlcpNAc-(1-4)-+ | Ala-(2-1)-PmN2-(2-5)-Glu-(2-1)-Ala-(2-8)-Murp2Ac-(1-5)-Glu | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | | | | Myr-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1---P-P | | Subst-(2-6)-+ | | R-3HOMyr-(1-3)-+ Subst = core oligosaccharide | Show graphically |
|
Show legend Show as text |
| Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1--P--1)--EtN-(?--/Ethanolamine/ | | EtN-(1--P--4)--+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-+ EtN-(1---P---P---4)-+ EtN-(1---P---P---4)-+ | | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-?)-Kdo-(2--/lipid A/ | L-gro-a-D-manHepp-(1-7)-+ | Show graphically |
|
Show legend Show as text |
| -8)-a-Neup5Ac-(2- | Show graphically |
|
Show legend Show as text |
| -4)-a-L-Fucp3Ac-(1-2)-b-D-Galp-(1-3)-a-D-GalpNAc-(1-3)-b-D-GalpNAc-(1- | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | 3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | 3HOMyr-(1-3)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | R-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1---P-P | | R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | Myr-(1-3)-R-3HOLau-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-8)-+ P-4)-+ | | a-Kdop-(2-4)-a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpNAc-(1-6)-a-D-GlcpNAc-(1---P---/BSA/ | Show graphically |
|
Show legend Show as text |
| P-4)-+ | a-Kdop-(2-4)-a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpNAc-(1-6)-a-D-GlcpNAc-(1--/BSA/ | Show graphically |
|
Show legend Show as text |
| P-4)-+ | a-Kdop-(2-8)-a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpNAc-(1-6)-a-D-GlcpNAc-(1--/BSA/ | Show graphically |
|
Show legend Show as text |
| b-D-GlcpA-(1-3)-b-D-GlcpNAc-(1-4)-b-D-GlcpA-(1-3)-b-D-GlcpNAc-(1-4)-b-D-GlcpA-(1-3)-D-GlcpNAc | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-D-GlcpA | Show graphically |
|
Show legend Show as text |
| b-D-GlcpA-(1-3)-b-D-GlcpNAc-(1-4)-D-GlcpA | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-b-D-GlcA-(1-3)-b-D-GlcpNAc-(1-4)-D-GlcpA | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-b-D-GlcA-(1-3)-D-GlcpNAc | Show graphically |
|
Show legend Show as text |
| b-D-GlcpA-(1-3)-b-D-GlcpNAc-(1-4)-b-D-GlcA-(1-3)-D-GlcpNAc | Show graphically |
|
Show legend Show as text |
| b-D-4dthrHex4enA-(1-3)-b-D-GlcpNAc-(1-4)-b-D-GlcA-(1-3)-D-GlcpNAc | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kdop-(2--/lipid IVA/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-5)-a-Kdop-(2-4)-a-Kdop-(2--/lipid IVA/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-5)-+ | a-D-GalpA-(1-5)-+ | | | a-D-GalpA-(1-4)-a-Kdop-(2-4)-a-Kdop-(2--/lipid IVA/ | Show graphically |
|
Show legend Show as text |
| a-D-GalpA-(1-4)-a-D-Manp-(1-5)-+ | a-D-GalpA-(1-5)-+ | | | a-D-GalpA-(1-4)-a-Kdop-(2-4)-a-Kdop-(2--/lipid IVA/ | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-P | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1---P---P---5)-G | Show graphically |
|
Show legend Show as text |
| a-D-Sugp-(1---P---P---5)-G Sug = 4-keto-3,6-dideoxy-threo-hexos-4-ulose = SMILES C[C@H]1O{1}[C@H](O)[C@@H](O)CC1=O | Show graphically |
|
Show legend Show as text |
| a-D-6dlyxHexp-4-ulo-(1---P---P---5)-G 6dlyxHex-4-ulo = 6-deoxy-lyxo-hexos-4-ulose | Show graphically |
|
Show legend Show as text |
| a-Colp-(1---P---P---5)-G | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kdo-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-4)-b-D-Glcp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| P-6)-D-Fru | Show graphically |
|
Show legend Show as text |
| P-5)-D-Rib | Show graphically |
|
Show legend Show as text |
| P-7)-D-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| P-4)-Ery | Show graphically |
|
Show legend Show as text |
| D-gro-D-manHepp-(1-P | Show graphically |
|
Show legend Show as text |
| D-gro-D-manHepp-(1---P---P---5)-A | Show graphically |
|
Show legend Show as text |
| P-7)-D-gro-D-manHepp-(1-P | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-3)-+ | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1--/(1->3) lipid A/ | Show graphically |
|
Show legend Show as text |
| a-D-Galp-(1-6)-+ | a-D-GlcpNAc-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1--/(1->3) lipid A/ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpN-(1-7)-L-gro-a-D-manHepp-(1-7)-+ | a-D-GlcpN-(1-3)-+ | a-Kdop-(2-4)-a-Kdop-(2-4)-+ | | | a-D-Glcp-(1-2)-a-D-Glcp-(1-2)-a-D-Galp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| b-D-Galp-(1-4)-+ | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1--/(1->3) lipid A/ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Myr-(1-3)-3HOMyr-(1-3)-+ | | | | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Subst-(2-6)-+ 3HOMyr-(1-3)-+ Subst = core oligosaccharide | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-+ | a-L-Rhap-(1-5)-a-Kdop-(2-4)-+ | L-gro-a-D-manHepp-(1-7)-+ | | | a-D-Galp-(1-6)-+ | P-4)-+ | | | | | a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | P-4)-+ | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp-(1-7)-+ | a-D-Galp-(1-6)-+ | P-4)-+ a-Kdop-(2-4)-+ | | | | ?%a-D-GlcpNAc-(1-7)-?%L-gro-a-D-manHepp-(1-2)-a-D-Glcp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | P-4)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| D-gro-b-D-manHepp-(1---P---P---5)-A | Show graphically |
|
Show legend Show as text |
| b-Kdop-(2--P--5)--C | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpN(%)Ac-(1- | Show graphically |
|
Show legend Show as text |
| b-D-GlcpNAc-(1-4)-+ | D-Ala-(2-1)-D-Ala-(2-1)-L-Lys-(2-5)-D-Glu-(2-1)-L-Ala-(2-8)-a-Murp2Ac-(1---P---/undecaprenol/ | Show graphically |
|
Show legend Show as text |
| a-D-Galf-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-L-Arap4N-(1--P--1)--Und | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-Glcp-(1-6)-a-D-Glcp-(1-P | | Myr-(1-3)-3HOMyr-(1-3)-+ | | 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpN-(1- | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOMyr-(1-3)-+ | | | | | Myr-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-4)-a-D-GlcpN-(1-P | | Subst-(2-6)-+ 3HOMyr-(1-3)-+ Subst = core oligosaccharide | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | Myr-(1-3)-3HOMyr-(1-3)-+ | | | Lau-(1-3)-3HOMyr-(1-2)-b-D-Glcp-(1-6)-a-D-Glcp-(1-P | | P-4)-+ | | 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | 3HOMyr-(1-3)-+ | | | 3HOMyr-(1-2)-b-D-Glcp-(1-6)-a-D-Glcp-(1-P | | P-4)-+ | | 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-Glcp-(1-6)-a-D-Glcp-(1-P | | 3HOMyr-(1-3)-+ | | 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| EtN-(1-0)-?%P---P--4)-+ | Subst-(1-3)-+ | a-Kdop-(2-4)-+ | | | ?%a-D-GlcpN(%)Ac-(1-7)-L-gro-a-D-manHepp-(1-7)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | P-4)-+ Subst = outer core | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-+ | -5)-a-Kdop-(2- | Show graphically |
|
Show legend Show as text |
| -3)-a-D-FucpN4Ac-(1-4)-b-D-ManpNAcA-(1-4)-a-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| b-GalNAc-(1-3)-a-Gal-(1-4)-b-Gal-(1-4)-b-Glc-(1-?)-CER-(?--/trimethylsylilethyl (instead of natural Cer)/ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | | | Subst-(1-?)-Kdo-(2-?)-Kdo-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ Subst = core oligosaccharide | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/5-aminopentyl/ | Show graphically |
|
Show legend Show as text |
| S-2)-Gc-(1-2)-+ | b-D-GlcpNAc-(1-6)-b-D-GlcpNAc-(1-6)-b-D-GlcpN-(1-6)-b-D-GlcpNAc-(1-6)-D-GlcpNAc | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kdop-(2-4)-+ | P-4)-+ P-4)-+ | | | | L-gro-a-D-manHepp-(1-7)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-+ | | | | | | | L-gro-a-D-manHepp-(1-5)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-3)-+ | ?%P---P--1)-+ | | | P-4)-+ | | | | | Lau-(1-3)-3HOMyr-(1-2)-+ | | | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN | | Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-3)-+ P-4)-+ a-Kdop-(2-4)-+ | | | L-gro-a-D-manHepp-(1-7)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop | P-4)-+ | Show graphically |
|
Show legend Show as text |
| P-4)-L-gro-a-D-manHepp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| P-4)-+ | L-gro-a-D-manHepp-(1-7)-L-gro-a-D-manHepp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| P-4)-+ | a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| P-4)-+ | L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-3)-+ | L-gro-a-D-manHepp-(1-7)-L-gro-a-D-manHepp-(1-1)-Me | P-4)-+ | Show graphically |
|
Show legend Show as text |
| -2)-b-Glc-(1- | Show graphically |
|
Show legend Show as text |
| -6)-b-D-GlcpNAc-(1- | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | ?%Myr-(1-3)-?%R-3HOMyr-(1-3)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| ?%Pam-(1-3)-R-3HOMyr-(1-2)-+ | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | /Variants 0/-b-D-GlcpN-(1-6)-a-D-GlcpN-(1--P--0)--?%P-1)-EtN | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ /Variants 0/ is: ?%b-L-Arap4N-(1--P--4)-- OR (exclusively) EtN-(1-0)-?%P---P--4)- | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOMyr-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN | | Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| -3)-b-D-GlcpN(%)Ac-(1- | Show graphically |
|
Show legend Show as text |
| b-Kdop-(2-4)-b-Kdop-(2-7)-b-Kdop | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | | Myr-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | Lau-(1-3)-R-3HOLau-(1-3)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOLau-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | Lau-(1-3)-R-3HOMyr-(1-2)-+ | | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-+ L-gro-a-D-manHepp-(1-7)-+ EtN-(1---P---P---4)-+ a-Kdop-(2-4)-+ | | | | | | | | {{{-a-D-Fucp4NAc-(1-4)-b-D-ManpNAcA-(1-4)-a-D-GlcpNAc-(1-3)-}}}/n=9/-a-D-Fucp4NAc-(1-4)-b-D-ManpNAcA-(1-4)-b-D-GlcpNAc-(1-3)-b-D-Glcp-(1-3)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | | P-4)-+ Myr-(1-3)-R-3HOMyr-(1-3)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | R-3HOMyr-(1-3)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| LIP-(1-1)-+ | b-D-Glcp-(1-3)-Gro | LIP-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| LIP-(1-1)-+ | b-D-Galp-(1-6)-b-D-Galp-(1-3)-Gro | LIP-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| ?%P-1)-+ | R-3HOMyr-(1-2)-+ | | | Myr-(1-3)-R-3HOMyr-(1-3)-+ | | | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN | | ?%P-4)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| EtN-(1--P--6)--+ | -4)-b-D-Glcp-(1-4)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| -3)-a-D-Fucp4NAc-(1-4)-b-D-ManpNAcA-(1-4)-a-D-GlcpNAc6(70%)Ac-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Fucp4NAc-(1-4)-b-D-ManpNAcA-(1-4)-a-D-GlcpNAc6Ac-(1-3)-a-D-Fucp4NAc-(1-4)-b-D-ManpNAcA-(1-4)-a-D-GlcpNAc6Ac-(1--/spacer-BSA/ | Show graphically |
|
Show legend Show as text |
| LIP-(1-3)-LIP-(1-2)-+ | P-4)-+ | | | b-D-Glcp-(1-3)-+ L-gro-a-D-manHepp-(1-7)-+ P-4)-+ a-Kdop-(2-4)-+ LIP-(1-2)-+ | | | | | | | | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ LIP-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-2)-+ | Myr-(1-3)-3HOMyr-(1-3)-+ | | | Lau-(1-3)-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-D-GlcpN | | P-4)-+ | | 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| Myr-(1-3)-3HOMyr-(1-3)-+ 3HOLau-(1-2)-+ | | Myr-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| Lau-(1-3)-R-3HOMyr-(1-2)-+ | R-3HOLau-(1-3)-+ | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HOLau-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HOMyr-(1-3)-+ | EtN-(1-0)-?%P---P--1)-+ | | | Lau-(1-3)-3HOMyr-(1-2)-+ | | | | | ?%b-L-Arap4N-(1--P--4)--b-D-GlcpN-(1-6)-a-D-GlcpN | | Myr-(1-3)-3HOMyr-(1-3)-+ 3HOMyr-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| b-D-Glcp-(1-3)-+ L-gro-a-D-manHepp-(1-7)-+ EtN-(1---P---P---4)-+ a-Kdop-(2-4)-+ | | | | a-D-Galp-(1-2)-a-D-Galp-(1-2)-a-D-Glcp-(1-3)-a-D-Glcp-(1-3)-L-gro-a-D-manHepp-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | P-4)-+ | Show graphically |
|
Show legend Show as text |
| R-3HOMyr-(1-2)-+ | P-4)-+ | | | R-3HOMyr-(1-3)-+ | | | | | Lau-(1-3)-R-3HOMyr-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | a-Kdop-(2-6)-+ | | R-3HOMyr-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| -3)-b-D-GlcpNAc-(1-4)-b-D-GlcpA-(1- | Show graphically |
|
Show legend Show as text |
| b-D-GlcpN(%)Ac | Show graphically |
|
Show legend Show as text |






| 8eLeg5Ac7Ac | Show graphically |
|
Show legend Show as text |
| b-Leg5Ac7Ac | Show graphically |
|
Show legend Show as text |
| a-Leg5Ac7Ac | Show graphically |
|
Show legend Show as text |
| a-4eLeg5Ac7Ac | Show graphically |
|
Show legend Show as text |
| b-4eLeg5Ac7Ac | Show graphically |
|
Show legend Show as text |
| -4)-a-4eLegp5Am7Ac8Ac-(2- | Show graphically |
|
Show legend Show as text |
| R-3HOiMyr-(1-3)-+ | iPam-(1-3)-3HOSte-(1-2)-+ | | | /Variants 0/-R-3HOiMyr-(1-3)-b-D-GlcpN3N-(1-6)-a-D-GlcpN3N-(1-P | | P-4)-+ 3HOSte-(1-2)-+ /Variants 0/ is: 27oxoMon-(1-3)- OR (exclusively) 27HOMon-(1-3)- | Show graphically |
|
Show legend Show as text |
| iPam-(1-3)-3HOSte-(1-2)-+ 3HOiMyr-(1-3)-+ | | /Variants 0/-3HOiMyr-(1-3)-b-D-GlcpN3N-(1-6)-a-D-GlcpN3N-(1-P | | P-4)-+ 3HOSte-(1-2)-+ /Variants 0/ is: Mon-(1-3)- OR (exclusively) 27oxoMon-(1-3)- OR (exclusively) LIP-(1-3)- iPam = iso-hexadecanoic acid C16:0 (i16:0); 27oxoMon = 27-oxo-octacosanoic acid C28:0 | Show graphically |
|
Show legend Show as text |
| 2,3HOiMyr-(1-3)-+ | iPam-(1-3)-/Variants 0/-+ | | | /Variants 1/-2,3HOiMyr-(1-3)-b-D-GlcpN3N-(1-6)-a-D-GlcpN3N-(1-P | | P-4)-+ /Variants 2/-+ /Variants 0/ is: 3HOBeh-(1-2)- OR (exclusively) 3HOAch-(1-2)- /Variants 1/ is: Mon-(1-3)- OR (exclusively) 27oxoMon-(1-3)- OR (exclusively) LIP-(1-3)- /Variants 2/ is: 3HOBeh-(1-2)- OR (exclusively) 3HOAch-(1-2)- 3HOBeh = 3-hydroxy-docosanoic acid - C22:0 | Show graphically |
|
Show legend Show as text |
| b-Leg | Show graphically |
|
Show legend Show as text |
| b-Leg5Ac7Ac | Show graphically |
|
Show legend Show as text |
| b-Leg5Am7Ac | Show graphically |
|
Show legend Show as text |
| a-Pse5Ac7Ac | Show graphically |
|
Show legend Show as text |
| b-Neu5Ac | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-Man2Ac | Show graphically |
|
Show legend Show as text |
| a-Neup5Ac-(2--P--5)--C | Show graphically |
|
Show legend Show as text |
| a-D-QuipNAc4NAc-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-RhaNAc4NAc | Show graphically |
|
Show legend Show as text |
| b-Legp5Ac7Ac-(2--P--5)--C | Show graphically |
|
Show legend Show as text |
| a-D-6dxylHexpNAc-4-ulo-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-QuipNAc4N-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| -4)-a-Legp5Am7Ac-(2- | Show graphically |
|
Show legend Show as text |
| 4eLegp5Ac7Ac | Show graphically |
|
Show legend Show as text |
| iPam-(1-3)-/Variants 0/-+ 3HOiMyr-(1-3)-+ | | /Variants 1/-3HOiMyr-(1-3)-b-D-GlcpN3N-(1-6)-a-D-GlcpN3N-(1-P | | P-4)-+ /Variants 2/-+ /Variants 0/ is: 3HOSte-(1-2)- OR (exclusively) 3HOBeh-(1-2)- OR (exclusively) 3HOAch-(1-2)- /Variants 1/ is: Mon-(1-3)- OR (exclusively) 27oxoMon-(1-3)- /Variants 2/ is: 3HOSte-(1-2)- OR (exclusively) 3HOBeh-(1-2)- OR (exclusively) 3HOAch-(1-2)- iPam = iso-hexadecanoic acid C16:0 (i16:0); 27oxoMon = 27-oxo-octacosanoic acid C28:0 | Show graphically |
|
Show legend Show as text |
| LIP-(1-3)-3HOC13-(1-3)-+ 3HOiC13-(1-3)-+ | | iC13-(1-3)-3HOPam-(1-2)-b-D-GlcpN3N-(1-6)-a-D-GlcpN3N-(1-P | | P-4)-+ 3HOPam-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| iPam-(1-3)-/Variants 4/-+ /Variants 0/-+ | | /Variants 3/-/Variants 2/-b-D-GlcpN3N-(1-6)-a-D-GlcpN3N-(1-P | | P-4)-+ /Variants 1/-+ /Variants 0/ is: 3HOiMyr-(1-3)- OR (exclusively) LIP-(1-3)- /Variants 1/ is: 3HOSte-(1-2)- OR (exclusively) 3HOBeh-(1-2)- OR (exclusively) 3HOAch-(1-2)- /Variants 2/ is: 3HOiMyr-(1-3)- OR (exclusively) LIP-(1-3)- /Variants 3/ is: Ccr-(1-3)- OR (exclusively) LIP-(1-3)- /Variants 4/ is: 3HOSte-(1-2)- OR (exclusively) 3HOBeh-(1-2)- OR (exclusively) 3HOAch-(1-2)- | Show graphically |
|
Show legend Show as text |

| -4)-b-D-ManpA-(1-4)-a-L-GulpA-(1- | Show graphically |
|
Show legend Show as text |
| -3)-a-D-Rhap-(1-3)-a-D-Rhap-(1-2)-a-D-Rhap-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-a-D-GalpN-(1--/inner core/ | L-Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| ?%3HODco-(1-3)-+ | /Variants 0/-3HOLau-(1-2)-+ | | | Kdop-(2-?)-Kdop-(2-6)-+ | | | | | Lau-(1-3)-3HOLau-(1-2)-+ | | | | | | | ?%b-L-Arap4N-(1--P--4)--b-D-GlcpN-(1-6)-a-D-GlcpN | | Pam-(1-3)-3HODco-(1-3)-+ | | ?%b-L-Arap4N-(1--P--1)--+ /Variants 0/ is: Lau-(1-3)- OR (exclusively) 2HOLau-(1-3)- | Show graphically |
|
Show legend Show as text |
| L-gro-D-manHepp7Cm-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp7Cm-(1-3)-L-gro-D-manHepp-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA-(1- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA-(1-4)-a-L-GulpA-(1- | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp7Cm-(1--/Allyl, 3-(2-ammonioethylthio)propyl, (CH2)3S(CH2)2NHCSNH-BSA/ | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp7Cm-(1-3)-L-gro-b-D-manHepp-(1-1)-Allyl | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1--/Allyl, 3-(2-ammonioethylthio)propyl, (CH2)3S(CH2)2NHCSNH-BSA/ | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp7Cm-(1-3)-L-gro-D-manHep | Show graphically |
|
Show legend Show as text |
| a-D-GalpNAc-(1-3)-L-gro-a-D-manHepp7Cm-(1--/Allyl, 3-(2-ammonioethylthio)propyl, (CH2)3S(CH2)2NHCSNH-BSA/ | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp7Cm-(1--/(CH2)3S(CH2)2NHCSNH-BSA/ | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1--/(CH2)3S(CH2)2NHCSNH-BSA/ | Show graphically |
|
Show legend Show as text |
| -2)-b-D-Glcp-(1-3)-a-L-FucpNAc-(1-3)-b-D-FucpNAc-(1- | Show graphically |
|
Show legend Show as text |
| /Variants 1/-R-3HOLau-(1-2)-+ | ?%L-Arap4N-(1--P--4)--+ | | | /Variants 0/-R-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | R-3HODco-(1-3)-+ | | ?%R-3HODco-(1-3)-+ /Variants 0/ is: Lau-(1-3)- OR (exclusively) S-2HOLau-(1-3)- /Variants 1/ is: Lau-(1-3)- OR (exclusively) S-2HOLau-(1-3)- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-a-L-GulpA-(1-4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-b-D-ManpA-(1- | Show graphically |
|
Show legend Show as text |
| a-Kdop-(2-4)-a-Kdop-(2--/lipid A/ | Show graphically |
|
Show legend Show as text |
| -4)-a-L-GulpNAc3NAmA-(1-4)-b-D-ManpNAc3NAcA-(1-3)-a-D-FucpNAc-(1- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpNAc3NAmA-(1-4)-a-L-GulpNAc3NAcA-(1-3)-b-D-FucpNAc-(1- | Show graphically |
|
Show legend Show as text |
| a-L-GulpNAc3NAmA-(1-4)-b-D-ManpNAc3NAcA-(1-3)-D-FucNAc-ol | Show graphically |
|
Show legend Show as text |
| b-D-ManpNAc3NAcA-(1-4)-a-L-GulpNAc3NAcA-(1-3)-D-FucNAc-ol | Show graphically |
|
Show legend Show as text |
| a-L-GulpNAc3NAcA-(1-4)-b-D-ManpNAc3NAcA-(1-3)-D-FucNAc-ol | Show graphically |
|
Show legend Show as text |
| a-L-GulpNAc3NEtA-(1-4)-b-D-ManpNAc3NAcA-(1-3)-D-FucNAc-ol | Show graphically |
|
Show legend Show as text |
| D-gro-b-L-3,9dgalNon5NAc7NAc-ulosonic-(2-3)-a-L-FucpNAm-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-D-QuipNAc-(1-8)-D-gro-b-L-3,9dgalNon5NAc7NAc-ulosonic-(2-3)-a-L-FucpNAm-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-3)-a-L-Rhap-(1-3)-a-L-Rhap | Show graphically |
|
Show legend Show as text |
| a-D-Rhap-(1-3)-a-D-Rhap-(1-3)-a-D-Rhap | Show graphically |
|
Show legend Show as text |
| a-D-Rhap-(1-2)-a-D-Rhap-(1-3)-a-D-Rhap-(1-3)-a-D-Rhap-(1--/Hexanolamine/ | Show graphically |
|
Show legend Show as text |
| -3)-a-D-Rhap-(1-2)-a-D-Rhap-(1-3)-a-D-Rhap-(1- | Show graphically |
|
Show legend Show as text |
| a-L-GulpA-(1-4)-b-D-ManpA-(1-4)-b-D-ManpA | Show graphically |
|
Show legend Show as text |
| -3)-a-L-FucpNAc-(1-3)-b-D-FucpNAc-(1-2)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| LIP-(1-2)-+ | LIP-(1-3)-+ | | | LIP-(1-2)-b-D-GlcpN-(1-6)-GlcN | LIP-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| a-L-GulpA-(1-4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-a-L-GulpA-(1-4)-a-L-GulpA-(1-4)-b-D-ManpA | Show graphically |
|
Show legend Show as text |
| -3)-a-L-Rhap-(1-4)-a-L-GalpNAcA-(1-3)-a-D-QuipNAc-(1- | Show graphically |
|
Show legend Show as text |
| -3)-a-L-Rhap2Ac-(1-4)-a-L-GalpNAcA-(1-3)-a-D-QuipNAc-(1- | Show graphically |
|
Show legend Show as text |
| a-D-GalpNAc-(1-4)-b-D-GlcpA2Ac3Ac-(1-3)-a-D-FucpNAc-(1-3)-a-D-QuipNAc | Show graphically |
|
Show legend Show as text |
| b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-a-L-GulpA-(1-4)-a-L-GulpA-(1-4)-b-D-ManpA | Show graphically |
|
Show legend Show as text |
| D-gro-a-D-3,9dmanNonp5NAc7NFo-ulosonic-(2-4)-b-D-Xylp-(1-3)-b-D-FucpNAc | Show graphically |
|
Show legend Show as text |
| -4)-a-D-GalpNAc-(1-4)-b-D-GlcpNAc3NAcA-(1-3)-a-D-FucpNAc-(1-3)-a-D-QuipNAc-(1- | Show graphically |
|
Show legend Show as text |
| P-4)-+ Lau-(1-2)-+ | | Lau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | Show graphically |
|
Show legend Show as text |
| -4)-a-L-GulpA-(1- | Show graphically |
|
Show legend Show as text |
| Lau-(1-3)-R-3HOLau-(1-2)-+ | R-3HODco-(1-3)-+ | | | Lau-(1-3)-R-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| {{{-a-D-Rhap-(1-3)-a-D-Rhap-(1-2)-a-D-Rhap-(1-3)-}}}/n=5/-a-D-Rha-(1-1)-Subst Subst = 6-amino-hexanol = SMILES O{1}CCCCCCN | Show graphically |
|
Show legend Show as text |
| a-D-Rhap-(1-2)-a-D-Rhap-(1-3)-a-D-Rhap-(1-3)-a-D-Rhap-(1-2)-a-D-Rhap-(1-3)-a-D-Rhap-(1-3)-a-D-Rhap-(1-2)-a-D-Rhap-(1-3)-a-D-Rhap-(1-3)-a-D-Rhap-(1-2)-a-D-Rhap-(1-3)-a-D-Rhap-(1-3)-a-D-Rhap-(1-2)-a-D-Rhap-(1-3)-a-D-Rhap-(1-3)-a-D-Rhap-(1--/(->1) hexanolamine-thiourea-albumin/ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| b-L-6daraHexpNAc-4-ulo-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-6dxylHexpNAc-4-ulo-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-Rhap-(1-6)-a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-a-D-GalN-(1--/inner core/ | L-Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-Rhap-(1-3)-+ | | | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-a-D-GalN-(1--/inner core/ | L-Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-a-D-GalpN-(1--/inner core/ | L-Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-+ | b-D-Glcp-(1-2)-a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-a-D-GalpN-(1--/inner core/ | L-Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-+ | | | a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1--/inner core/ | L-Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-+ | | | Subst-(1-3)-a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1--/inner core/ | L-Ala-(1-2)-+ Subst = O-antigen | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-+ | P-6)-+ EtN-(1--75%P--2)--+ | | | | a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdo | | L-Ala-(1-2)-+ P-4)-+ | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA-(1- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA-(1-4)-a-L-GulpA-(1- | Show graphically |
|
Show legend Show as text |
| a-D-6dxylHexp-4-ulo-(1---P---P---5)-dT | Show graphically |
|
Show legend Show as text |
| a-D-6dlyxHexp-4-ulo-(1---P---P---5)-dT | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-a-D-GalpN-(1-1)-Me | L-Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAcA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-ribHexpNAcA-3-ulo-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc3NA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-GlcpNAc3NAcA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-ManpNAc3NAcA-(1---P---P---5)-U | Show graphically |
|
Show legend Show as text |
| a-D-GalpNAc-(1-3)-L-gro-a-D-manHepp7Cm-(1--/OCH2CH2CH2SCH2CH2NH2/ | Show graphically |
|
Show legend Show as text |
| L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp7Cm-(1--/OCH2CH2CH2SCH2CH2NH2/ | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpNAc3NAmA-(1-4)-b-D-ManpNAc3NAmA-(1-3)-a-D-FucpNAc-(1- | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-+ P-6)-+ P-2)-+ a-Kdop-(2-4)-+ | | | | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-a-D-GalpN?(%)Ac-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | Ala-(1-2)-+ P-4)-+ | Show graphically |
|
Show legend Show as text |
| ?%P---P--6)-+ | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-+ | EtN-(1-0)-?%P---P--2)-+ a-Kdop-(2-4)-+ | | | | ?%b-D-Glcp-(1-2)-a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | L-Ala-(1-2)-+ ?%P---P--4)-+ | Show graphically |
|
Show legend Show as text |
| ?%P---P--6)-+ | a-D-Glcp-(1-4)-+ | | | a-D-Glcp-(1-6)-+ | | EtN-(1-0)-?%P---P--2)-+ a-Kdop-(2-4)-+ | | | | | ?%Subst-(1-3)-a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | L-Ala-(1-2)-+ ?%P---P--4)-+ Subst = O-antigen | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1---P---P---5)-G | Show graphically |
|
Show legend Show as text |
| a-D-6dlyxHexp-4-ulo-(1---P---P---5)-G | Show graphically |
|
Show legend Show as text |
| a-D-Sug-(1---P---P---5)-G Sug = aD6dlyxHexp-4-gem-diol = SMILES C[C@H]1O{1}[C@H](O)[C@@H](O)[C@@H](O)C1(O)O | Show graphically |
|
Show legend Show as text |
| a-D-Rhap-(1---P---P---5)-G-(?--/G/ | Show graphically |
|
Show legend Show as text |
| 3HODco-(1-3)-+ 3HOLau-(1-2)-+ | | 3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 3HODco-(1-3)-+ 3HOLau-(1-2)-+ | | Lau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | 3HODco-(1-3)-+ | | | Lau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | Pam-(1-3)-3HODco-(1-3)-+ | | | Lau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | 3HODco-(1-3)-+ | | | Lau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | P-4)-+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | Pam-(1-3)-3HODco-(1-3)-+ | | | Lau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | P-4)-+ | Show graphically |
|
Show legend Show as text |
| P-4)-+ EtN-(1-0)-?%P---P--2)-+ a-Kdop-(2-4)-+ | | | Ala-(1-2)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | P-6)-+ P-4)-+ | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA-(1-4)-b-D-ManpA3Ac-(1-4)-b-D-ManpA2Ac-(1-4)-a-L-GulpA-(1-4)-b-D-ManpA2Ac-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Manp-(1-2)-+ | -3)-b-D-Manp-(1-3)-b-D-Manp-(1-3)-a-L-Rhap-(1-3)-b-D-Glcp-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-+ P---P--6)-+ EtN-(1---P---P---2)-+ a-Kdop-(2-4)-+ | | | | b-D-Glcp-(1-2)-a-L-Rhap?(%)Ac-(1-6)-a-D-Glcp-(1-4)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | L-Ala-(1-2)-+ P---P--4)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp6(%)Ac-(1-4)-+ | a-D-Glcp-(1-6)-+ | P---P--6)-+ EtN-(1---P---P---2)-+ a-Kdop-(2-4)-+ | | | | | Subst-(1-3)-a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | L-Ala-(1-2)-+ P---P--4)-+ Subst = O-antigen | Show graphically |
|
Show legend Show as text |
| ?%P---P--6)-+ | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-+ | EtN-(1-0)-?%P---P--2)-+ a-Kdop-(2-4)-+ | | | | b-D-Glcp-(1-2)-a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | L-Ala-(1-2)-+ ?%P---P--4)-+ | Show graphically |
|
Show legend Show as text |
| ?%P---P--6)-+ | a-D-Glcp-(1-4)-+ | | | a-D-Glcp-(1-6)-+ | | EtN-(1-0)-?%P---P--2)-+ a-Kdop-(2-4)-+ | | | | | Subst-(1-3)-a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | L-Ala-(1-2)-+ ?%P---P--4)-+ Subst = O-antigen | Show graphically |
|
Show legend Show as text |
| b-D-Rhap-(1-3)-3HODco-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| b-D-Rhap-(1-2)-b-D-Rhap-(1-3)-3HODco-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-2)-a-L-Rhap-(1-3)-3HODco-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-a-D-GalpN-(1--/inner core/ | /Variants 0/-+ /Variants 0/ is: L-Ala-(1-2)- OR (exclusively) Ac-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-+ | | | a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1--/inner core/ | /Variants 0/-+ /Variants 0/ is: L-Ala-(1-2)- OR (exclusively) Ac-2)- | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-+ | | | a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpNAc-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-+ | | | a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1-1)-Me | L-Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| L-Ala2Ac-(1-2)-+ | a-D-Glcp-(1-6)-+ | | | a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1-1)-Me | a-D-Glcp-(1-4)-+ | Show graphically |
|
Show legend Show as text |
| b-L-6daraHexp-4-ulo-(1---P---P---5)-G | Show graphically |
|
Show legend Show as text |
| b-L-Fucp-(1---P---P---5)-G | Show graphically |
|
Show legend Show as text |
| b-L-Quip-(1---P---P---5)-G | Show graphically |
|
Show legend Show as text |
| a-D-Rhap-(1---P---P---5)-G | Show graphically |
|
Show legend Show as text |
| b-L-6dlyxHexp-4-ulo-(1---P---P---5)-dT | Show graphically |
|
Show legend Show as text |
| b-L-Rhap-(1---P---P---5)-dT | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-+ | b-D-Glcp-(1-2)-a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-a-D-GalpN | Ala-(1-2)-+ | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-4)-+ | a-D-Glcp-(1-6)-+ | | | {{{-Subst-(1-3)-}}}/n=1-?/-a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN | Ala-(1-2)-+ Subst = O-unit or O-antigen polymer | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOLau-(1-2)-+ | | | | | a-Kdop-(2-4)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | 3HODco-(1-3)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOLau-(1-2)-+ | | | | | a-D-Glcp-(1-4)-+ | | | | | | | a-D-Glcp-(1-6)-+ | P-6)-+ EtN-(1---P---P---2)-+ a-Kdop-(2-4)-+ | | | | | | | | | | | a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | | | L-Ala-(1-2)-+ P-4)-+ 3HODco-(1-3)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | P-4)-+ | | | Lau-(1-3)-3HOLau-(1-2)-+ | | | | | a-D-Glcp-(1-4)-+ | | | | | | | a-D-Glcp-(1-6)-+ | P-6)-+ EtN-(1---P---P---2)-+ a-Kdop-(2-4)-+ | | | | | | | | | | | a-L-Rhap2Ac-(1-4)-a-L-GalpNAcA-(1-3)-b-D-QuipNAc-(1-3)-a-L-Rhap-(1-3)-b-D-Glcp-(1-3)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2-6)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | | | L-Ala-(1-2)-+ P-4)-+ 3HODco-(1-3)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | 3HODco-(1-3)-+ | | | Lau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | ?%3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA-(1- | Show graphically |
|
Show legend Show as text |
| -4)-a-L-GulpA-(1- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA2(%)Ac3(%)Ac-(1-4)-a-L-GulA-(1-4)-a-L-GulA-(1- | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-3)-3HODco-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-2)-a-L-Rhap-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| /Variants 1/-R-3HOLau-(1-2)-+ | R-3HODco-(1-3)-+ | | | /Variants 0/-R-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HODco-(1-3)-+ /Variants 0/ is: Lau-(1-3)- OR (exclusively) R-3HOLau-(1-3)- /Variants 1/ is: Lau-(1-3)- OR (exclusively) R-3HOLau-(1-3)- | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-3)-3HOSte-(1-3)-3HOSte | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-2)-a-L-Rhap-(1-3)-3HOSte-(1-3)-3HOSte | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-2)-a-L-Rhap-(1-3)-R-3HODco-(1-3)-R-3HODco-(1-1)-Me | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-2)-a-L-Rhap-(1-3)-R-3HODco-(1-3)-R-3HODco | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-3)-3HODco-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-2)-a-L-Rhap-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| a-L-Rhap-(1-3)-3HODco | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | ?%Pam-(1-3)-3HODco-(1-3)-+ | | | 2HOLau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1--P--0)--?%P-1)-EtN | | ?%b-L-Arap4N-(1--P--4)--+ | | ?%3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| -4)-D-GlcpN-(1-4)-D-GlcpNAc-(1-4)-D-GalpN-(1-4)-D-GalpNAc-(1-4)-D-GlcpN-(1-4)-D-GlcpNAc-(1-4)-D-GalpN-(1- | Show graphically |
|
Show legend Show as text |
| /Variants 1/-+ /Variants 0/-+ | | -4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-a-L-GulpA-(1-4)-a-L-GulpA-(1-4)-b-D-ManpA-(1-4)-a-L-GulpA-(1- /Variants 0/ is: Ac-3)- OR (exclusively) Ac-2)- /Variants 1/ is: Ac-3)- OR (exclusively) Ac-2)- | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | Lau-(1-3)-3HODco-(1-3)-+ | | | Lau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1--P--1)--b-L-Arap4N | b-L-Arap4N-(1--P--4)--+ | Show graphically |
|
Show legend Show as text |
| -4)-b-D-GlcpN(50%)Ac-(1-4)-b-D-GalpN(50%)Ac-(1- | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA3Ac-(1-4)-b-D-ManpA2Ac-(1-4)-b-D-ManpA-(1-4)-a-L-GulpA2Ac-(1-4)-b-D-ManpA-(1- | Show graphically |
|
Show legend Show as text |
| R-3HOLau-(1-2)-+ | R-3HODco-(1-3)-+ | | | Lau-(1-3)-R-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ | | R-3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| /Variants 1/-+ /Variants 0/-+ | | -4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-a-L-GulpA-(1-4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-b-D-ManpA-(1- /Variants 0/ is: Ac-3)- OR (exclusively) Ac-2)- /Variants 1/ is: Ac-3)- OR (exclusively) Ac-2)- | Show graphically |
|
Show legend Show as text |
| Lau-(1-3)-3HOLau-(1-2)-+ | 3HODco-(1-3)-+ | | | Lau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN-(1-P | | P-4)-+ 3HODco-(1-3)-+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | Lau-(1-3)-3HOLau-(1-2)-+ | | | ?%b-L-Arap4N-(1--P--4)--b-D-GlcpN-(1-6)-a-D-GlcpN | | 3HODco-(1-3)-+ | | ?%b-L-Arap4N-(1--P--1)--+ | Show graphically |
|
Show legend Show as text |
| 2HOLau-(1-3)-3HOLau-(1-2)-+ | ?%b-L-Arap4N-(1--P--4)--+ | | | 3HOLau-(1-3)-3HOLau-(1-2)-b-D-GlcpN-(1-6)-a-D-GlcpN | | 3HODco-(1-3)-+ | | ?%b-L-Arap4N-(1--P--1)--+ | Show graphically |
|
Show legend Show as text |
| -4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-b-D-ManpA-(1-4)-a-L-GulpA-(1-4)-b-D-ManpA-(1- | Show graphically |
|
Show legend Show as text |
| a-D-Glcp-(1-6)-b-D-Glcp-(1-3)-+ P-6)-+ EtN-(1---P---P---2)-+ a-Kdop-(2-4)-+ | | | | b-D-Glcp-(1-2)-a-L-Rhap-(1-6)-a-D-Glcp-(1-4)-a-D-GalpN-(1-3)-L-gro-a-D-manHepp7Cm-(1-3)-L-gro-a-D-manHepp-(1-5)-a-Kdop-(2--/lipid A/ | | L-Ala-(1-2)-+ P-4)-+ | Show graphically |
|
Show legend Show as text |
| -4)-{{{-b-D-ManpA-(1-4)-}}}{{{-a-L-GulpA-(1-4)-}}}a-L-GulpA-(1- | Show graphically |
|
Show legend Show as text |


| New query | Export IDs | Home | Help |
Execution: 22 sec