|
Show legend Show as text |
Found 2 structures.
Displayed structures from 1 to 2
| a-D-Manp-(1-2)-+ | a-D-Manp-(1-2)-+ | | | a-D-Manp-(1-2)-+ | | | | | a-D-Manp-(1-2)-+ | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | a-D-Manp-(1-2)-+ | | | | | | | | | | | | | a-D-Manp-(1-6)-+ | | | | | | | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-+ | | | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | | | | | | | b-D-Araf-(1-2)-{{{-a-D-Araf-(1-5)-}}}/n=5/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-3)-+ | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-+ | | | | | | | | | b-D-Araf-(1-2)-{{{-a-D-Araf-(1-5)-}}}/n=6/-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=3/-a-D-Araf-(1-3)-+ | | | | | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-+ | | | | | | | | | a-D-Manp-(1-2)-a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ | | | | | | | | | a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | | | LIP-(1-?)-a-D-Manp-(1-?)-+ LIP-(1-1)-+ | | | | | | | | a-D-Sugf-(1-4)-a-D-Manp-(1-2)-a-D-Manp-(1-2)-b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=2/-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-{{{-a-D-Araf-(1-5)-}}}/n=11/-a-D-Araf-(1-5)-D-Araf-(1-?)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-6)-a-D-Manp-(1-?)-myoIno-(1--P--3)--Gro | | Suc-(1-2)-+ LIP-(1-2)-+ Sug = 5-methylthio-xylose = SMILES O{1}[C@@H]1[C@@H]([C@H]([C@@H](CSC)O1)O)O | Show graphically |
|
Show legend Show as text |
Structure type: structural motif or average structure
Trivial name: lipoarabinomannan (LAM)
Compound class: cell wall polysaccharide
Contained glycoepitopes: IEDB_130701,IEDB_1309625,IEDB_136104,IEDB_140116,IEDB_141793,IEDB_141828,IEDB_141829,IEDB_141831,IEDB_143632,IEDB_144983,IEDB_144993,IEDB_152206,IEDB_153220,IEDB_153762,IEDB_153763,IEDB_76933,IEDB_857718,IEDB_857732,IEDB_857735,IEDB_857736,IEDB_983930,SB_136,SB_191,SB_196,SB_198,SB_44,SB_67,SB_72
Mycobacteria produce carbohydrates of exceptional structures that are covalently modified by unique substituents, whose functional characterization could expand our understanding of how mycobacteria adapt to their environment.
polysaccharides, modification, Mycobacteria, covalent, arabinogalactan (AG), lipoarabinomannan (LAM), lipomannan (LM)
NCBI PubMed ID: 29443974| b-D-Araf-(1-2)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-3)-+ | b-D-Araf-(1-2)-a-D-Araf-(1-5)-+ | | | b-D-Araf-(1-2)-a-D-Araf-(1-3)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf-(1-5)-a-D-Araf | Show graphically |
|
Show legend Show as text |
Structure type: fragment of a bigger structure
Trivial name: arabinofuran
Compound class: cell wall polysaccharide
Contained glycoepitopes: IEDB_1309625,IEDB_134619,IEDB_857717,IEDB_857718,IEDB_857720,IEDB_857736
Cell surface carbohydrates have been proven optimal targets for vaccine development. Conjugation of polysaccharides to a carrier protein triggers a T-cell dependent immune response to the glycan moiety. Licensed glycoconjugate vaccines are produced by chemical conjugation of capsular polysaccharides to prevent meningitis caused by meningococcus, pneumococcus and Haemophilus influenzae type b. However, other classes of carbohydrates (O-antigens, exopolysaccharides, wall/teichoic acids) represent attractive targets for developing vaccines.Recent analysis from WHO/CHO underpins alarming concern towards antibiotic resistant bacteria, such as the so called ESKAPE pathogens (Enterococcus faecium, Staphylococcus aureus, Klebsiella pneumoniae, Acinetobacter baumannii, Pseudomonas aeruginosa and Enterobacter spp.) and additional pathogens such as Clostridium difficile and Group A Streptococcus. Fungal infections are also becoming increasingly invasive for immunocompromised patients or hospitalized individuals. Other emergencies could derive from bacteria which spread during environmental calamities (Vibrio cholerae) or with potential as bioterrorism weapons (Burkholderia pseudomallei and mallei, Francisella tularensis). Vaccination could aid reducing the use of broad spectrum antibiotics and provide protection by herd immunity also to individuals who are not vaccinated.This review analyses structural and functional differences of the polysaccharides exposed on the surface of emerging pathogenic bacteria, combined with medical need and technological feasibility of corresponding glycoconjugate vaccines.
carbohydrates, glycoconjugates, vaccines, glycoengineering, antimicrobial resistance
NCBI PubMed ID: 29547971| New query | Export IDs | Home | Help |
Execution: 1 sec