CSDB: Search results

Taxonomic group: plant / Streptophyta (Phylum: Streptophyta)

NCBI PubMed ID: 4630785
Journal NLM ID: 0376600
Publisher: Japanese Biochemical Society
Institutions: The Faculty of Science, Osaka City University, Osaka, Japan

The branched dextrins produced from waxy rice starch β-limit dextrin by Bacillus subtilis' saccharifying α-amylse [EC 3. 2. 1. 1] were isolated by the multiple development paper chromatography and their chemical structures were investigated. The analyses using β-amylase [EC 3. 2. 1. 2], glucoamylase [EC 3. 2. 1. 3], pullulanase, and pullulan α-1, 4-glucoside hydrolase revealed that they were doubly branched dextrins with the following structures: 63-α-(62-α-glucosylmaltosyl)-maltotriose, 63-α-, 65-α-diglucosylmaltopentaose, and 63-α-(63-α-glucosylmaltotriosyl)-maltotriose. The results were discussed in connection with the interior structure of β-limit dextrin.

Structure type: oligomer
Location inside paper: fig. 5, dextrin #3
Contained glycoepitopes: IEDB_140629,IEDB_142488,IEDB_144998,IEDB_146664,IEDB_420419,IEDB_420421,IEDB_423115,IEDB_857742,IEDB_983931,SB_192

Methods: TLC, enzymatic digestion, PC, phenol-sulfuric acid method, the Somogyi-Nelson method, the Shaffer-Somogyi method
Comments, role: Parent molecule: starch, limit dextrin

NCBI Taxonomy refs (TaxIDs): 4530
Reference(s) to other database(s): GTC:G13189BF, CCSD:11260, CBank-STR:11960
Show glycosyltransferases

There are 2 chemically distinct structures. Please, select:

OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@@H]3[C@@H](CO)O[C@H](OC[C@H]4O[C@H](O[C@@H]5[C@@H](CO)O[C@H](O[C@@H]6[C@@H](CO)OC(O)[C@H](O)[C@H]6O)[C@H](O)[C@H]5O)[C@H](O)[C@@H](O)[C@@H]4O)[C@H](O)[C@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O

SVG MW SMILES 3D mol Ionize

Structure type: oligomer
Location inside paper: fig. 8, dextrin #4-1
Contained glycoepitopes: IEDB_140629,IEDB_142488,IEDB_144998,IEDB_146664,IEDB_420417,IEDB_420419,IEDB_420421,IEDB_423115,IEDB_857742,IEDB_983931,SB_192

Methods: TLC, enzymatic digestion, PC, phenol-sulfuric acid method, the Somogyi-Nelson method, the Shaffer-Somogyi method
Comments, role: Parent molecule: starch, limit dextrin

NCBI Taxonomy refs (TaxIDs): 4530
Reference(s) to other database(s): GTC:G84717EN, CCSD:11262, CBank-STR:13810
Show glycosyltransferases

There are 2 chemically distinct structures. Please, select:

OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@@H]3[C@@H](CO)O[C@H](O[C@@H]4[C@@H](CO[C@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)O[C@H](O[C@@H]5[C@@H](CO)O[C@H](O[C@@H]6[C@@H](CO)OC(O)[C@H](O)[C@H]6O)[C@H](O)[C@H]5O)[C@H](O)[C@H]4O)[C@H](O)[C@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O

SVG MW SMILES 3D mol Ionize

Structure type: oligomer
Location inside paper: fig. 9, dextrin #4-2
Contained glycoepitopes: IEDB_140629,IEDB_142488,IEDB_144998,IEDB_146664,IEDB_420419,IEDB_420420,IEDB_420421,IEDB_423115,IEDB_857742,IEDB_983931,SB_192

Methods: TLC, enzymatic digestion, PC, phenol-sulfuric acid method, the Somogyi-Nelson method, the Shaffer-Somogyi method
Comments, role: Parent molecule: starch, limit dextrin

NCBI Taxonomy refs (TaxIDs): 4530
Reference(s) to other database(s): GTC:G35598VH, CCSD:11261, CBank-STR:13893
Show glycosyltransferases

There are 2 chemically distinct structures. Please, select:

OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@@H]3[C@@H](CO)O[C@H](O[C@@H]4[C@@H](CO)O[C@H](OC[C@H]5O[C@H](O[C@@H]6[C@@H](CO)O[C@H](O[C@@H]7[C@@H](CO)OC(O)[C@H](O)[C@H]7O)[C@H](O)[C@H]6O)[C@H](O)[C@@H](O)[C@@H]5O)[C@H](O)[C@H]4O)[C@H](O)[C@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O

SVG MW SMILES 3D mol Ionize

Structure type: polymer chemical repeating unit
Location inside paper: fig. 11
Trivial name: pullulan
Compound class: EPS, O-polysaccharide, cell wall polysaccharide, glucan, polysaccharide
Contained glycoepitopes: IEDB_140629,IEDB_142488,IEDB_144998,IEDB_146664,IEDB_420419,IEDB_420420,IEDB_420421,IEDB_857742,IEDB_983931,SB_192

Methods: TLC, enzymatic digestion, PC, phenol-sulfuric acid method, the Somogyi-Nelson method, the Shaffer-Somogyi method
Comments, role: possible structure

Related record ID(s): 41589, 49953, 49977, 49978, 49979, 49995, 49999, 50000, 50002, 50007, 50014, 50071, 50081, 50082, 50083, 50111, 50113
NCBI Taxonomy refs (TaxIDs): 4530
Reference(s) to other database(s): GTC:G71532WE, CCSD:45938, CBank-STR:4859, GenDB:KY767023; GenDB:KY767024
Show glycosyltransferases

There is only one chemically distinct structure:

*OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)O[C@H](*)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O

SVG MW SMILES 3D mol Ionize