CSDB glycosyltransferase search

4 glycosyltransferase activities have been found.
Please note that CSDB GT database covers only a few species: Arabidopsis thaliana, Escherichia coli, Saccharomyces cerevisiae, Acinetobacter baumannii.

Enzyme / Gene	Activity	Object	References
Enzyme name: ugt51p UniProt ID: Q06321* CAZy family: GT1 Gene name: ATG26/UGT51 Gene GenBank ID: 850886*	Synthesized dimer: bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H] Donor (ID 33616): aDGlcp(1-P-P-5)xXnucU Acceptor (ID 34896): Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H] Status: semi-direct evidence in vivo Confirmation methods: mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation) ID: 299 Notes: UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors	Organism (ID 17220): Saccharomyces cerevisiae UTL-7A Expressed in: E. coli Full structure (ID 20490): CSDB ID(s): 42839, 44557, 44558, 44559, 45044, 48154, 48199, 50368, 60932, 61476, 61969, 62123, 62299, 62387, 62464, 62469, 62504, 62746, 62753, 63027, 63214, 63289, 63445, 63676, 63755, 63892, 64042, 64128, 64648, 64665, 64819, 64883, 65044, 65049, 65223, 65264, 65268, 65276, 65365, 65400, 65452, 65589, 66158, 66192, 66656, 66748, 67062, 67301, 67327, 67759, 67799, 67955, 68341, 68586, 68733, 68900, 101110, 101132, 108826, 121975, 121976, 121977, 145377, 147448, 201132, 299859 Molecule role: membrane glycolipid	Warnecke et al. 1999 DOI: 10.1074/jbc.274.19.13048
Synthesized dimer: bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H] Donor (ID 33616): aDGlcp(1-P-P-5)xXnucU Acceptor (ID 34896): Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H] Status: semi-direct evidence in vivo Confirmation methods: mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation) ID: 512 Notes: UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors	Organism (ID 12218): Avena sativa Expressed in: E. coli Full structure (ID 20490): CSDB ID(s): 42839, 45044, 48154, 48199, 50368, 61476, 61969, 62123, 62299, 62387, 62464, 62469, 62504, 62746, 62753, 63027, 63214, 63289, 63445, 63676, 63755, 63892, 64042, 64128, 64648, 64665, 64819, 64883, 65044, 65049, 65223, 65264, 65268, 65276, 65365, 65400, 65452, 65589, 66158, 66192, 66656, 66748, 67062, 67301, 67327, 67759, 67799, 67955, 68341, 68586, 68733, 68900, 290698, 299859 Molecule role: membrane glycolipid
Synthesized dimer: bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H] Donor (ID 33616): aDGlcp(1-P-P-5)xXnucU Acceptor (ID 34896): Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H] Status: semi-direct evidence in vivo Confirmation methods: mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation) ID: 517 Notes: UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors	Organism (ID 9097): Dictyostelium discoideum Expressed in: E. coli Full structure (ID 20490): CSDB ID(s): 42839, 45044, 48154, 48199, 50368, 61476, 61969, 62123, 62299, 62387, 62464, 62469, 62504, 62746, 62753, 63027, 63214, 63289, 63445, 63676, 63755, 63892, 64042, 64128, 64648, 64665, 64819, 64883, 65044, 65049, 65223, 65264, 65268, 65276, 65365, 65400, 65452, 65589, 66158, 66192, 66656, 66748, 67062, 67301, 67327, 67759, 67799, 67955, 68341, 68586, 68733, 68900, 290698, 299859 Molecule role: membrane glycolipid
Synthesized dimer: bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H] Donor (ID 33616): aDGlcp(1-P-P-5)xXnucU Acceptor (ID 34896): Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H] Status: semi-direct evidence in vivo Confirmation methods: mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation) ID: 522 Notes: UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors	Organism (ID 10327): Pichia pastoris Expressed in: E. coli Full structure (ID 20490): CSDB ID(s): 42839, 45044, 48154, 48199, 50368, 61476, 61969, 62123, 62299, 62387, 62464, 62469, 62504, 62746, 62753, 63027, 63214, 63289, 63445, 63676, 63755, 63892, 64042, 64128, 64648, 64665, 64819, 64883, 65044, 65049, 65223, 65264, 65268, 65276, 65365, 65400, 65452, 65589, 66158, 66192, 66656, 66748, 67062, 67301, 67327, 67759, 67799, 67955, 68341, 68586, 68733, 68900, 290698, 299859 Molecule role: membrane glycolipid

#GTR ID	Enzyme name	Enzyme group	Enzyme Genbank ID	Derived ID mark	Enzyme Uniprot ID	Derived ID mark	CAZY family	Gene name	Gene Genbank ID	Derived ID mark	Gene cluster	Full structure CSDB structure ID	Side product CSDB structure ID	Full structure	Full structure is fragment (0|1)	Synthesized bond	Synthesized bond location (from root ~ subst position)	Donor structure ID	Substrate structure	Confirmation status	Methods used	Notes	Molecule role	Molecule is a model of role (0|1)	Molecule is a precursor of role (0|1)	Main CSDB record ID	Additional CSDB record IDs	CSDB organism IDs	Organism names	Organs and tissues	References (;-separated)
299	ugt51p				Q06321	*	GT1	ATG26/UGT51	850886	*		20490		bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	0	bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	1~3	aDGlcp(1-P-P-5)xXnucU	Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	semi-direct	mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation)	UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors	membrane glycolipid	0	0		42839,44557,44558,44559,45044,48154,48199,50368,60932,61476,61969,62123,62299,62387,62464,62469,62504,62746,62753,63027,63214,63289,63445,63676,63755,63892,64042,64128,64648,64665,64819,64883,65044,65049,65223,65264,65268,65276,65365,65400,65452,65589,66158,66192,66656,66748,67062,67301,67327,67759,67799,67955,68341,68586,68733,68900,101110,101132,108826,121975,121976,121977,145377,147448,201132,299859	17220	Saccharomyces cerevisiae UTL-7A	E. coli	Warnecke et al. 1999 (doi: 10.1074/jbc.274.19.13048)	
512	ugt51p				Q06321	*	GT1	ATG26/UGT51	850886	*		20490		bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	0	bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	1~3	aDGlcp(1-P-P-5)xXnucU	Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	semi-direct	mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation)	UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors	membrane glycolipid	0	0		42839,45044,48154,48199,50368,61476,61969,62123,62299,62387,62464,62469,62504,62746,62753,63027,63214,63289,63445,63676,63755,63892,64042,64128,64648,64665,64819,64883,65044,65049,65223,65264,65268,65276,65365,65400,65452,65589,66158,66192,66656,66748,67062,67301,67327,67759,67799,67955,68341,68586,68733,68900,290698,299859	12218	Avena sativa 	E. coli	Warnecke et al. 1999 (doi: 10.1074/jbc.274.19.13048)	
517	ugt51p				Q06321	*	GT1	ATG26/UGT51	850886	*		20490		bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	0	bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	1~3	aDGlcp(1-P-P-5)xXnucU	Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	semi-direct	mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation)	UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors	membrane glycolipid	0	0		42839,45044,48154,48199,50368,61476,61969,62123,62299,62387,62464,62469,62504,62746,62753,63027,63214,63289,63445,63676,63755,63892,64042,64128,64648,64665,64819,64883,65044,65049,65223,65264,65268,65276,65365,65400,65452,65589,66158,66192,66656,66748,67062,67301,67327,67759,67799,67955,68341,68586,68733,68900,290698,299859	9097	Dictyostelium discoideum 	E. coli	Warnecke et al. 1999 (doi: 10.1074/jbc.274.19.13048)	
522	ugt51p				Q06321	*	GT1	ATG26/UGT51	850886	*		20490		bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	0	bDGlcp(1-3)Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	1~3	aDGlcp(1-P-P-5)xXnucU	Subst // Subst = β-sitosterol = SMILES O{3}[C@H](C1)CC[C@@]2(C)C1=CC[C@]3([H])[C@@]2([H])CC[C@@]4(C)[C@]3([H])CC[C@]4([C@@H](C)CC[C@@H](CC)C(C)C)[H]	semi-direct	mutation; expression in E. coli; in vitro (homogenate); in vitro (membrane preparation)	UGT51 gene encodes UDP-glucose:sterol glucosyltransferase which can use different sterols such as cholesterol, sitosterol, and ergosterol as sugar acceptors	membrane glycolipid	0	0		42839,45044,48154,48199,50368,61476,61969,62123,62299,62387,62464,62469,62504,62746,62753,63027,63214,63289,63445,63676,63755,63892,64042,64128,64648,64665,64819,64883,65044,65049,65223,65264,65268,65276,65365,65400,65452,65589,66158,66192,66656,66748,67062,67301,67327,67759,67799,67955,68341,68586,68733,68900,290698,299859	10327	Pichia pastoris 	E. coli	Warnecke et al. 1999 (doi: 10.1074/jbc.274.19.13048)